CAS 59152-49-7

2-(iodomethyl)-2,3-dihydro-1-benzofuran

Description:

2-(Iodomethyl)-2,3-dihydro-1-benzofuran is an organic compound characterized by its unique structure, which includes a benzofuran moiety and an iodomethyl group. This compound features a fused benzene and furan ring, contributing to its aromatic properties and potential reactivity. The presence of the iodomethyl group introduces a halogen, which can enhance its electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which facilitates its use in synthetic organic chemistry. Due to the presence of iodine, it may exhibit biological activity and could be of interest in medicinal chemistry. However, handling precautions are necessary due to the potential toxicity associated with halogenated compounds. Overall, 2-(iodomethyl)-2,3-dihydro-1-benzofuran serves as a valuable intermediate in the synthesis of more complex organic molecules.

Formula: C₉H₉IO

InChI: InChI=1/C9H9IO/c10-6-8-5-7-3-1-2-4-9(7)11-8/h1-4,8H,5-6H2

SMILES: c1ccc2c(c1)CC(CI)O2

Synonyms:

• 2-Iodomethyl-2,3-dihydro-benzofuran
• 2-(Iodomethyl)-2,3-dihydro-1-benzofuran

2-(Iodomethyl)-2,3-dihydro-1-benzofuran

CAS: 59152-49-7

2-(Iodomethyl)-2,3-dihydro-1-benzofuran is an efficient synthesis of 2-iodo-1,3-benzofuran. It is an intermediate in the synthesis of organic compounds that contain a benzene ring with two adjacent hydrogens substituted by iodine atoms. This process is called "aromatization."

Formula: C₉H₉IO

Purity: Min. 95%

Molecular weight: 260.07 g/mol

Ref: 3D-JCA15249