CAS 59163-72-3

2-(4-chlorophenyl)ethyl acetate

Description:

2-(4-Chlorophenyl)ethyl acetate, with the CAS number 59163-72-3, is an organic compound characterized by its ester functional group. It features a 4-chlorophenyl group attached to an ethyl acetate moiety, which contributes to its chemical properties. This compound is typically a colorless to pale yellow liquid with a sweet, fruity odor, indicative of its ester nature. It is moderately soluble in water but more soluble in organic solvents such as ethanol and ether. The presence of the chlorophenyl group can influence its reactivity and biological activity, making it of interest in various fields, including pharmaceuticals and agrochemicals. The compound may exhibit moderate volatility and can be flammable, necessitating careful handling and storage. Additionally, it may undergo hydrolysis in the presence of water, leading to the formation of the corresponding alcohol and acid. Overall, 2-(4-chlorophenyl)ethyl acetate is a versatile compound with applications in synthesis and as a potential intermediate in chemical reactions.

Formula: C₁₀H₁₁ClO₂

InChI: InChI=1/C10H11ClO2/c1-8(12)13-7-6-9-2-4-10(11)5-3-9/h2-5H,6-7H2,1H3

SMILES: CC(=O)OCCc1ccc(cc1)Cl