CAS 59169-70-9
:2-Amino-5-chlorobenzoic acid 1-methylhydrazide
Description:
2-Amino-5-chlorobenzoic acid 1-methylhydrazide, with the CAS number 59169-70-9, is an organic compound that features both amino and hydrazide functional groups, contributing to its reactivity and potential applications in various fields. This compound typically appears as a crystalline solid and is characterized by its molecular structure, which includes a benzoic acid moiety substituted with a chlorine atom and an amino group at specific positions on the aromatic ring. The presence of the hydrazide group enhances its ability to participate in condensation reactions, making it useful in synthetic organic chemistry. Additionally, the compound may exhibit biological activity, which could be explored for pharmaceutical applications. Its solubility properties are influenced by the functional groups present, often making it soluble in polar solvents. As with many chemical substances, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, 2-Amino-5-chlorobenzoic acid 1-methylhydrazide is a compound of interest for researchers in both synthetic and medicinal chemistry.
Formula:C8H10ClN3O
InChI:InChI=1S/C8H10ClN3O/c1-12(11)8(13)6-4-5(9)2-3-7(6)10/h2-4H,10-11H2,1H3
InChI key:InChIKey=XWQSAOBUBKQAII-UHFFFAOYSA-N
SMILES:C(N(C)N)(=O)C1=C(N)C=CC(Cl)=C1
Synonyms:- Benzoic acid, 2-amino-5-chloro-, 1-methylhydrazide
- 2-Amino-5-chlorobenzoic acid 1-methylhydrazide
- 1-(2′-Amino-5′-chlorobenzoyl)-1-methylhydrazine
- 2-Amino-5-chloro-N-methylbenzohydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
