CAS 59174-12-8

N'-hydroxy-2-thiophen-2-ylethanimidamide

Description:

N'-hydroxy-2-thiophen-2-ylethanimidamide is a chemical compound characterized by its unique structure, which includes a thiophene ring and an amidine functional group. This compound typically exhibits properties associated with both the thiophene moiety and the amidine group, such as potential biological activity and reactivity. The presence of the hydroxy group suggests it may participate in hydrogen bonding, influencing its solubility and interaction with other molecules. As a thiophene derivative, it may display aromatic characteristics, contributing to its stability and electronic properties. The compound's CAS number, 59174-12-8, allows for precise identification in chemical databases. While specific applications may vary, compounds of this nature are often explored in medicinal chemistry for their potential as pharmaceuticals or agrochemicals due to their ability to interact with biological systems. Overall, N'-hydroxy-2-thiophen-2-ylethanimidamide represents a class of compounds with diverse chemical behavior and potential utility in various fields of research.

Formula: C₆H₈N₂OS

InChI: InChI=1/C6H8N2OS/c7-6(8-9)4-5-2-1-3-10-5/h1-3,9H,4H2,(H2,7,8)

SMILES: c1cc(CC(=N)NO)sc1

Synonyms:

• 2-thiopheneethanimidamide, N'-hydroxy-
• N-hydroxy-2-(2-thienyl)ethanimidamide

N'-Hydroxy-2-(thiophen-2-yl)acetimidamide

CAS: 59174-12-8

Formula: C₆H₈N₂OS

Molecular weight: 156.2055

Ref: IN-DA00EJ4U

Thiophene-2-acetamidoxime

CAS: 59174-12-8

Thiophene-2-acetamidoxime

Purity: 95%

Color and Shape: Solid

Molecular weight: 156.21g/mol

Ref: 54-OR0749

N’-hydroxy-2-(2-thienyl)ethanimidamide

CAS: 59174-12-8

Formula: C₆H₈N₂OS

Purity: 95.0%

Molecular weight: 156.2

Ref: 10-F495423

N'-Hydroxy-2-(2-thienyl)ethanimidamide

CAS: 59174-12-8

Versatile small molecule scaffold

Formula: C₆H₈N₂OS

Purity: Min. 95%

Molecular weight: 156.21 g/mol

Ref: 3D-JCA17412