CAS 591779-91-8

(3R,5R)-3,5-dimethylmorpholine

Description:

(3R,5R)-3,5-dimethylmorpholine is a cyclic amine characterized by its morpholine structure, which consists of a six-membered ring containing both oxygen and nitrogen atoms. This compound features two methyl groups attached to the 3rd and 5th carbon atoms of the morpholine ring, contributing to its unique stereochemistry and potentially influencing its physical and chemical properties. It is typically a colorless to pale yellow liquid with a distinctive amine-like odor. The presence of the nitrogen atom allows for hydrogen bonding, which can affect its solubility in various solvents, often making it soluble in water and organic solvents. This compound may exhibit basic properties due to the nitrogen atom, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its chirality, indicated by the (3R,5R) designation, suggests that it may have specific interactions in biological systems, which could be relevant in pharmaceutical applications. Overall, (3R,5R)-3,5-dimethylmorpholine is of interest in both synthetic chemistry and potential medicinal chemistry applications.

Formula: C₆H₁₃NO

InChI: InChI=1/C6H13NO/c1-5-3-8-4-6(2)7-5/h5-7H,3-4H2,1-2H3/t5-,6-/m1/s1

SMILES: C[C@@H]1COC[C@@H](C)N1

Synonyms:

• morpholine, 3,5-dimethyl-, (3R,5R)-
• (3R,5R)-3,5-Dimethylmorpholine
• (R,R)-3,5-Dimethylmorpholine

Morpholine, 3,5-diMethyl-, (3R,5R)-

CAS: 591779-91-8

Formula: C₆H₁₃NO

Purity: 98%

Color and Shape: Liquid

Molecular weight: 115.1735

Ref: IN-DA00EID4

(R,R)-3,5-Dimethylmorpholine

CAS: 591779-91-8

(R,R)-3,5-Dimethylmorpholine

Purity: 98%

Ref: 54-OR1040948

(3R,5R)-3,5-DIMETHYLMORPHOLINE

CAS: 591779-91-8

Purity: 98%

Molecular weight: 115.18

Ref: 10-F795572