CAS 59189-98-9
:2-Fluoro-4-methylbenzoyl chloride
Description:
2-Fluoro-4-methylbenzoyl chloride is an organic compound characterized by its aromatic structure, which includes a benzoyl chloride functional group and a fluorine atom at the ortho position relative to the carbonyl group. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity, particularly due to the presence of the acyl chloride functional group, which can readily participate in nucleophilic substitution reactions. The fluorine atom introduces unique electronic properties, influencing the compound's reactivity and polarity. It is generally soluble in organic solvents such as dichloromethane and ether but is less soluble in water. Safety considerations are important when handling this compound, as it can be corrosive and may release toxic gases upon contact with moisture. Its applications often lie in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals, where it serves as an intermediate in various chemical reactions. Proper storage and handling protocols should be followed to ensure safety and stability.
Formula:C8H6ClFO
InChI:InChI=1S/C8H6ClFO/c1-5-2-3-6(8(9)11)7(10)4-5/h2-4H,1H3
InChI key:InChIKey=SVSVOPWCUHQFAM-UHFFFAOYSA-N
SMILES:C(Cl)(=O)C1=C(F)C=C(C)C=C1
Synonyms:- Benzoyl chloride, 2-fluoro-4-methyl-
- 2-Fluoro-4-methylbenzoyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Fluoro-4-methylbenzoyl chloride
CAS:2-Fluoro-4-methylbenzoyl chlorideFormula:C8H6ClFOPurity:techColor and Shape: brown. low melting/fused solidMolecular weight:172.58g/mol

