CAS 5919-26-6

2-nitro-1H-pyrrole

Description:

2-Nitro-1H-pyrrole is an organic compound characterized by a five-membered aromatic heterocyclic structure containing both nitrogen and oxygen atoms. It features a nitro group (-NO2) attached to the second carbon of the pyrrole ring, which enhances its reactivity and polar nature. This compound typically appears as a yellow to orange solid and is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the nitro group contributes to its electrophilic properties, making it a useful building block in the synthesis of more complex molecules. Additionally, 2-nitro-1H-pyrrole can participate in various chemical reactions, including nucleophilic substitutions and reductions. It is important to handle this compound with care due to its potential toxicity and environmental impact. As with many nitro compounds, it may also exhibit explosive properties under certain conditions, necessitating appropriate safety measures during storage and use.

Formula: C₄H₄N₂O₂

InChI: InChI=1/C4H4N2O2/c7-6(8)4-2-1-3-5-4/h1-3,5H

SMILES: c1cc([nH]c1)N(=O)=O

Synonyms:

• 1H-pyrrole, 2-nitro-
• 2-Nitropyrrole
• Pyrrole, 2-nitro-

2-nitro-1H-pyrrole

CAS: 5919-26-6

Formula: C₄H₄N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 112.0868

Ref: IN-DA00375I

2-Nitro-1H-pyrrole

CAS: 5919-26-6

2-Nitro-1H-pyrrole

Purity: 99%

Color and Shape: Solid

Molecular weight: 112.09g/mol

Ref: 54-OR54468

2-Nitro-1H-pyrrole

CAS: 5919-26-6

Formula: C₄H₄N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 112.088

Ref: 10-F093328