
CAS 592-39-2
:(T-4)-Trifluoro(piperidine)boron
Description:
(T-4)-Trifluoro(piperidine)boron, with the CAS number 592-39-2, is a chemical compound that features a boron atom bonded to a trifluoromethyl group and a piperidine ring. This compound is characterized by its unique structure, which combines the properties of boron and fluorine, making it a useful reagent in various chemical reactions, particularly in organic synthesis and catalysis. The trifluoromethyl group imparts significant electronegativity, enhancing the compound's reactivity and stability under certain conditions. Additionally, the piperidine moiety contributes to the compound's solubility in organic solvents and its ability to participate in nucleophilic reactions. (T-4)-Trifluoro(piperidine)boron is often utilized in the development of pharmaceuticals and agrochemicals, where its reactivity can be harnessed to form complex molecular architectures. Safety precautions should be observed when handling this compound, as it may pose health risks due to its fluorinated nature and potential reactivity.
Formula:C5H11BF3N
InChI:InChI=1S/C5H11BF3N/c7-6(8,9)10-4-2-1-3-5-10/h10H,1-5H2
InChI key:InChIKey=OLZSTHNRCLGIBT-UHFFFAOYSA-N
SMILES:[B+3]([F-])([F-])([F-])[NH]1CCCCC1
Synonyms:- Piperidine, compd. with BF3 (1:1)
- Piperidine, compd. with boron fluoride (BF3) (1:1)
- Piperidine, compd. with trifluoroborane (1:1)
- Boron, trifluoro(piperidine)-, (T-4)-
- Piperidine, compd. with BF3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
