CAS 59255-94-6

2-Bromo-3-fluoronitrobenzene

Description:

2-Bromo-3-fluoronitrobenzene is an aromatic compound characterized by the presence of a bromine atom, a fluorine atom, and a nitro group attached to a benzene ring. Its molecular structure features a nitro group (-NO2) and halogen substituents, which significantly influence its chemical reactivity and physical properties. This compound typically appears as a pale yellow to brown solid and is known for its moderate solubility in organic solvents. The presence of electronegative halogens and the nitro group contributes to its electron-withdrawing characteristics, making it a useful intermediate in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, 2-Bromo-3-fluoronitrobenzene can participate in various chemical reactions, such as nucleophilic substitutions and electrophilic aromatic substitutions, due to the reactivity of its functional groups. Safety precautions should be taken when handling this compound, as it may pose health risks and environmental hazards.

Formula: C₆H₃BrFNO₂

InChI: InChI=1/C6H3BrFNO2/c7-6-4(8)2-1-3-5(6)9(10)11/h1-3H

SMILES: c1cc(c(c(c1)N(=O)=O)Br)F

Synonyms:

• 2-Bromo-1-fluoro-3-nitrobenzene
• 1-Bromo-2-fluoro-6-nitrobenzene
• 2-BROMO-3-FLUORONITROBENZENE

2-Bromo-3-fluoronitrobenzene

CAS: 59255-94-6

Formula: C₆H₃BrFNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 219.9959

Ref: IN-DA00E8OZ

2-Bromo-3-fluoronitrobenzene

CAS: 59255-94-6

2-Bromo-3-fluoronitrobenzene

Formula: C₆H₃BrFNO₂

Purity: ≥95%

Color and Shape: yellow solid

Molecular weight: 220.00g/mol

Ref: 54-PC5083

2-Bromo-3-fluoronitrobenzene

CAS: 59255-94-6

Formula: C₆H₃BrFNO₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 219.997

Ref: 10-F092957