CAS 59256-25-6

4-[[(4-Bromophenyl)sulfonyl]amino]benzoic acid hydrazide

Description:

4-[[(4-Bromophenyl)sulfonyl]amino]benzoic acid hydrazide, with the CAS number 59256-25-6, is a chemical compound characterized by its sulfonamide functional group and hydrazide moiety. This compound typically exhibits properties associated with both hydrazides and sulfonamides, including potential biological activity. It is often used in pharmaceutical research due to its ability to interact with various biological targets. The presence of the bromophenyl group may enhance its lipophilicity and influence its reactivity and solubility in organic solvents. The compound's structure suggests it may participate in hydrogen bonding, which can affect its stability and interactions in biological systems. Additionally, its potential applications may include use as an intermediate in organic synthesis or as a lead compound in drug development. As with many chemical substances, safety and handling precautions should be observed, given the presence of bromine and sulfonamide functionalities, which may pose specific health risks.

Formula: C₁₃H₁₂BrN₃O₃S

InChI: InChI=1S/C13H12BrN3O3S/c14-10-3-7-12(8-4-10)21(19,20)17-11-5-1-9(2-6-11)13(18)16-15/h1-8,17H,15H2,(H,16,18)

InChI key: InChIKey=BKMWNNPETITMMY-UHFFFAOYSA-N

SMILES: S(NC1=CC=C(C(NN)=O)C=C1)(=O)(=O)C2=CC=C(Br)C=C2

Synonyms:

• Benzoic acid, 4-[[(4-bromophenyl)sulfonyl]amino]-, hydrazide
• 4-[[(4-Bromophenyl)sulfonyl]amino]benzoic acid hydrazide

4-Bromo-N-[4-(hydrazinecarbonyl)phenyl]benzene-1-sulfonamide

CAS: 59256-25-6

Versatile small molecule scaffold

Formula: C₁₃H₁₂BrN₃O₃S

Purity: Min. 95%

Molecular weight: 370.22 g/mol

Ref: 3D-JCA25625