
CAS 59259-90-4
:5-(Dimethoxymethyl)-1,3-benzodioxole
Description:
5-(Dimethoxymethyl)-1,3-benzodioxole, with the CAS number 59259-90-4, is a chemical compound characterized by its unique structure, which includes a benzodioxole moiety substituted with a dimethoxymethyl group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential reactivity due to the presence of the dioxole ring. The dimethoxymethyl substituent can influence its solubility and polarity, making it more soluble in organic solvents. It may also participate in various chemical reactions, including electrophilic substitutions, due to the electron-donating nature of the methoxy groups. The compound is of interest in organic synthesis and may have applications in pharmaceuticals or as an intermediate in the production of other chemical entities. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 5-(Dimethoxymethyl)-1,3-benzodioxole represents a versatile compound within the realm of organic chemistry.
Formula:C10H12O4
InChI:InChI=1S/C10H12O4/c1-11-10(12-2)7-3-4-8-9(5-7)14-6-13-8/h3-5,10H,6H2,1-2H3
InChI key:InChIKey=UNANDJIJRBQOOF-UHFFFAOYSA-N
SMILES:C(OC)(OC)C=1C=C2C(=CC1)OCO2
Synonyms:- 3,4-Methylenedioxybenzaldehyde dimethyl acetal
- 1,3-Benzodioxole, 5-(dimethoxymethyl)-
- Piperonal, dimethyl acetal
- 5-(Dimethoxymethyl)-1,3-benzodioxole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
