CAS 5926-35-2
:Bis(trimethylsilyl)methyl chloride
Description:
Bis(trimethylsilyl)methyl chloride, with the CAS number 5926-35-2, is an organosilicon compound characterized by its unique structure that includes two trimethylsilyl groups attached to a central carbon atom, which is also bonded to a chlorine atom. This compound is typically a colorless to pale yellow liquid and is known for its reactivity, particularly in nucleophilic substitution reactions due to the presence of the chlorine atom. It serves as a useful reagent in organic synthesis, especially in the field of silicon chemistry, where it can be employed to introduce trimethylsilyl groups into various organic molecules. The presence of the trimethylsilyl groups enhances the compound's stability and solubility in organic solvents, making it a valuable intermediate in the synthesis of more complex silanes and siloxanes. Additionally, it is important to handle this compound with care, as it may release hydrochloric acid upon hydrolysis, and appropriate safety measures should be taken to mitigate any potential hazards.
Formula:C19H16N2O4
InChI:InChI=1/C19H16N2O4/c1-12(22)20-19(14-6-9-15(10-7-14)21(24)25)18-16-5-3-2-4-13(16)8-11-17(18)23/h2-11,19,23H,1H3,(H,20,22)
SMILES:CC(=NC(c1ccc(cc1)N(=O)=O)c1c2ccccc2ccc1O)O
Synonyms:- Bistrimethylsilylchloromethane
- Chloro-bis(trimethylsilyl)methane
- (Chloromethanediyl)Bis(Trimethylsilane)
- N-[(2-hydroxynaphthalen-1-yl)(4-nitrophenyl)methyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Bis(trimethylsilyl) methyl chloride
CAS:S02750 - Bis(trimethylsilyl) methyl chloride
Formula:C7H19ClSi2Color and Shape:ClearMolecular weight:194.85
