
CAS 59261-05-1
:L-Arginine, [2S-[2α,5α,6β(S*)]]-6-[[amino(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate
Description:
L-Arginine, with the CAS number 59261-05-1, is an amino acid that plays a crucial role in various physiological processes. It is classified as a semi-essential amino acid, meaning that while the body can synthesize it, dietary intake may be necessary under certain conditions, such as during periods of growth or illness. L-Arginine is known for its role in protein synthesis and as a precursor to nitric oxide, a vital signaling molecule that helps regulate blood flow and vascular function. The compound features a complex structure that includes a thiazolidine ring and multiple functional groups, contributing to its biological activity. It is soluble in water and exhibits basic properties due to the presence of an amino group. L-Arginine is often used in dietary supplements and has been studied for its potential benefits in cardiovascular health, immune function, and exercise performance. However, its efficacy and safety can vary based on individual health conditions and dosages.
Formula:C16H19N3O5S·xC6H14N4O2
InChI:InChI=1S/C16H19N3O5S.C6H14N4O2/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7;7-4(5(11)12)2-1-3-10-6(8)9/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24);4H,1-3,7H2,(H,11,12)(H4,8,9,10)/t9-,10-,11+,14-;4-/m10/s1
InChI key:InChIKey=GMJWAEBOPBLHBW-GOINNNTOSA-N
SMILES:C(O)(=O)[C@@H]1N2[C@@]([C@H](NC([C@H](N)C3=CC=C(O)C=C3)=O)C2=O)(SC1(C)C)[H].C(CCNC(=N)N)[C@@H](C(O)=O)N
Synonyms:- L-Arginine, [2S-[2α,5α,6β(S*)]]-6-[[amino(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylate
- 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-[[amino(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-, [2S-[2α,5α,6β(S*)]]-, compd. with L-arginine
- Amoxycillin arginine salt
- Amoxycillin L-arginine salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Amoxycillin arginine salt
CAS:Amoxycillin arginine salt is a bioactive chemical.Formula:C22H33N7O7SColor and Shape:SolidMolecular weight:539.61
