CAS 59290-82-3

3-Nitroisonicotinic acid

Description:

3-Nitroisonicotinic acid is an organic compound that belongs to the class of nitro-substituted pyridine carboxylic acids. It features a pyridine ring with a carboxylic acid group and a nitro group positioned at the 3rd carbon relative to the nitrogen atom of the pyridine. This compound is typically characterized by its solid state at room temperature, exhibiting a crystalline structure. It is soluble in polar solvents such as water and alcohols, which is influenced by the presence of the carboxylic acid group. The nitro group contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and reductions. 3-Nitroisonicotinic acid may also exhibit biological activity, which can be explored for potential applications in pharmaceuticals or agrochemicals. Its properties, such as melting point, boiling point, and spectral characteristics, can vary based on the specific conditions and purity of the sample. Overall, this compound is of interest in both synthetic organic chemistry and medicinal chemistry research.

Formula: C₆H₄N₂O₄

InChI: InChI=1S/C6H4N2O4/c9-6(10)4-1-2-7-3-5(4)8(11)12/h1-3H,(H,9,10)

InChI key: InChIKey=YKPIUHZVTZWEEW-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(N(=O)=O)=CN=CC1

Synonyms:

• 3-Nitro-4-pyridinecarboxylic acid
• 3-Nitropyridine-4-carboxylic acid
• 4-Carboxy-3-nitropyridine
• 4-Pyridinecarboxylic acid, 3-nitro-
• Isonicotinic acid, 3-nitro-
• 3-Nitroisonicotinic acid

3-Nitroisonicotinic acid

CAS: 59290-82-3

Formula: C₆H₄N₂O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 168.1070

Ref: IN-DA003JTE

3-Nitroisonicotinic acid

CAS: 59290-82-3

3-Nitroisonicotinic acid

Purity: 98%

Molecular weight: 168.11g/mol

Ref: 54-OR16446

3-Nitro-4-pyridinecarboxylic acid

CAS: 59290-82-3

Formula: C₆H₄N₂O₄

Purity: 98%+(HPLC);RG

Color and Shape: Solid, White powder

Molecular weight: 168.108

Ref: 10-F044368