CAS 593-81-7
:Trimethylammonium chloride
Description:
Trimethylammonium chloride, with the CAS number 593-81-7, is a quaternary ammonium salt characterized by its structure, which consists of a central nitrogen atom bonded to three methyl groups and a chloride ion. This compound is typically a white crystalline solid that is soluble in water and polar organic solvents, making it useful in various applications. It exhibits properties such as being hygroscopic, meaning it can absorb moisture from the air. Trimethylammonium chloride is often used as a surfactant, in the synthesis of other chemical compounds, and as a phase transfer catalyst in organic reactions. Additionally, it can serve as a reagent in biochemical applications, particularly in the study of membrane proteins and cell biology. Due to its quaternary ammonium nature, it can also exhibit antimicrobial properties, making it relevant in disinfectant formulations. However, handling should be done with care, as it can be irritating to the skin and eyes.
Formula:C3H9N·ClH
InChI:InChI=1S/C3H9N.ClH/c1-4(2)3;/h1-3H3;1H
InChI key:InChIKey=SZYJELPVAFJOGJ-UHFFFAOYSA-N
SMILES:N(C)(C)C.Cl
Synonyms:- Hegzadesil
- Methanamine, N,N-dimethyl-, hydrochloride
- Methanamine, N,N-dimethyl-, hydrochloride (1:1)
- N,N-dimethylmethanaminium chloride
- Trimethylamine Chlorhydrate
- Trimethylamine HCL
- Trimethylamine hydrochloric acid
- Trimethylamine monohydrochloride
- Trimethylammonium chloride
- Trimethylamine, hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
Trimethylamine Hydrochloride
CAS:Controlled ProductFormula:C3H9N·HClPurity:>97.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:95.57trimethylamine hydrochloride
CAS:Controlled ProductFormula:C3H10ClNPurity:97%Color and Shape:SolidMolecular weight:95.57Trimethylamine Hydrochloride
CAS:Controlled ProductFormula:C3H10ClNPurity:97%Color and Shape:SolidMolecular weight:95.5712Trimethylammonium chloride, 10mM (in DMSO)
CAS:Controlled ProductTrimethylammonium chloride, 10mM (in DMSO)Purity:≥98%Molecular weight:95.57g/molTrimethylamine HCl
CAS:Controlled ProductFormula:C3H9N·HClColor and Shape:White To Off-White SolidMolecular weight:59.11 36.46Trimethylamine Hydrochloride
CAS:Controlled ProductTrimethylamine HydrochloridePurity:98%Molecular weight:95.57g/molTrimethylammonium chloride
CAS:Controlled Product<p>Trimethylammonium chloride, a fishy odor compound, is linked to decay, infections, bad breath, high choline intake, and the genetic disorder trimethylaminuria.</p>Formula:C3H10ClNPurity:99.79%Color and Shape:White Solid CrystallineMolecular weight:95.57Trimethylamine Monohydrochloride
CAS:Controlled ProductFormula:C3H9N·ClHColor and Shape:NeatMolecular weight:95.5712







