CAS 593-92-0
:Ethene, 1,1-dibromo-
Description:
Ethene, 1,1-dibromo- is an organic compound characterized by the presence of two bromine atoms attached to the first carbon of the ethene molecule, which consists of a two-carbon alkene structure. Its molecular formula is C2H2Br2, indicating that it contains two carbon atoms, two hydrogen atoms, and two bromine atoms. This compound is a colorless liquid at room temperature and is known for its reactivity due to the presence of the double bond between the carbon atoms. The bromine substituents enhance its electrophilic character, making it susceptible to nucleophilic attack. Ethene, 1,1-dibromo- is used in various chemical syntheses and can participate in reactions such as nucleophilic substitution and elimination. It is important to handle this compound with care, as brominated compounds can be hazardous and may pose environmental risks. Additionally, it is essential to consider its storage and disposal according to safety regulations to minimize any potential health and environmental impacts.
Formula:C2H2Br2
InChI:InChI=1S/C2H2Br2/c1-2(3)4/h1H2
InChI key:InChIKey=IWHJPYXAFGKABF-UHFFFAOYSA-N
SMILES:C(Br)(Br)=C
Synonyms:- 1,1-Dibromoethene
- Brn 1697555
- Ethene, 1,1-dibromo-
- Ethylene, 1,1-dibromo-
- Ethylene, 1,1-dibromo- (6CI,7CI,8CI)
- Vinylidene bromide
- gem-Dibromoethylene
- 1,1-Dibromoethylene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.


