CAS 59302-19-1

(2S)-2-acetamido-3-(4-hydroxy-3-iodo-phenyl)propanamide

Description:

(2S)-2-acetamido-3-(4-hydroxy-3-iodo-phenyl)propanamide, with the CAS number 59302-19-1, is an organic compound characterized by its amide functional group and a substituted phenyl ring. This compound features a chiral center at the second carbon, which contributes to its stereochemistry. The presence of an acetamido group indicates that it has an amine functional group attached to an acetyl moiety, enhancing its solubility in polar solvents. The 4-hydroxy-3-iodo-phenyl substituent introduces both hydroxyl and iodine functionalities, which can influence the compound's reactivity and biological activity. This structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the iodine atom, which can enhance the compound's interaction with biological targets. Additionally, the hydroxyl group may contribute to hydrogen bonding, affecting the compound's physical properties such as melting point and solubility. Overall, this compound's unique structural features make it of interest for further research in various chemical and biological contexts.

Formula: C₁₁H₁₃IN₂O₃

InChI: InChI=1/C11H13IN2O3/c1-6(15)14-9(11(13)17)5-7-2-3-10(16)8(12)4-7/h2-4,9,16H,5H2,1H3,(H2,13,17)(H,14,15)/t9-/m0/s1

SMILES: CC(=N[C@@H](Cc1ccc(c(c1)I)O)C(=N)O)O

N-Acetyl-3-iodo-L-tyrosine amide

CAS: 59302-19-1

Molecular weight: 348.14

Ref: 7W-GM5203

N-Acetyl-3-iodo-L-tyrosine Amide

Controlled Product

CAS: 59302-19-1

Applications Used in the synthesis of 3-iodo-L-thyronine and its iodinated derivatives.
References Block, P., et al.: J. Med. Chem., 19, 1067 (1976),

Formula: C₁₁H₁₃IN₂O₃

Color and Shape: Neat

Molecular weight: 348.14

Ref: TR-A179410