CAS 59318-41-1

3-hydrazino-5-(4-methoxyphenyl)-1,2,4-triazine

Description:

3-Hydrazino-5-(4-methoxyphenyl)-1,2,4-triazine is a chemical compound characterized by its triazine ring structure, which is a six-membered heterocyclic compound containing three nitrogen atoms. This compound features a hydrazino group (-NH-NH2) at the 3-position and a para-methoxyphenyl group (-OCH3) at the 5-position of the triazine ring, contributing to its unique reactivity and potential biological activity. The presence of the hydrazino group suggests that it may participate in various chemical reactions, including those involving hydrazones or azo compounds. The methoxy group enhances the lipophilicity and may influence the compound's interaction with biological targets. This compound may exhibit properties such as antimicrobial, antitumor, or anti-inflammatory activities, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, 3-hydrazino-5-(4-methoxyphenyl)-1,2,4-triazine represents a versatile scaffold for further chemical modifications and potential applications in pharmaceuticals.

Formula: C₁₀H₁₁N₅O

InChI: InChI=1/C10H11N5O/c1-16-8-4-2-7(3-5-8)9-6-12-15-10(13-9)14-11/h2-6H,11H2,1H3,(H,13,14,15)

SMILES: COc1ccc(cc1)c1cnnc(n1)NN

3-Hydrazino-5-(4-methoxyphenyl)-1,2,4-triazine

CAS: 59318-41-1

Formula: C₁₀H₁₁N₅O

Purity: 95.0%

Molecular weight: 217.232

Ref: 10-F061224