CymitQuimica logo

CAS 5932-27-4

:

Ethyl pyrazole-3-carboxylate

Description:
Ethyl pyrazole-3-carboxylate is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features an ethyl ester functional group and a carboxylate moiety, contributing to its reactivity and solubility properties. Ethyl pyrazole-3-carboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its applications in medicinal chemistry, particularly in the synthesis of various pharmaceuticals and agrochemicals. The presence of the pyrazole ring allows for potential biological activity, making it a subject of interest in drug development. Additionally, the compound may exhibit moderate to high solubility in organic solvents, while its stability can be influenced by environmental factors such as temperature and pH. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity or reactivity.
Formula:C6H8N2O2
InChI:InChI=1/C6H8N2O2/c1-2-10-6(9)5-3-4-7-8-5/h3-4H,2H2,1H3,(H,7,8)
InChI key:MSPOSRHJXMILNK-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cc[nH]n1
Synonyms:
  • 3-(Ethoxycarbonyl)pyrazole
  • 3-Carbethoxypyrazole
  • Ethyl 1H-pyrazole-3-carboxylate
  • 1-[4-(2-Chlorobenzyl)Piperazin-1-Yl]-3-Methylbutan-1-One
  • ethyl 1H-pyrazole-5-carboxylate
  • Ethyl Pyrazole-3-Carboxylic
Found 5 products.