CAS 5932-62-7
:4-tert-butylcycloheptanone
Description:
4-tert-Butylcycloheptanone is a cyclic ketone characterized by its unique structure, which includes a cycloheptane ring substituted with a tert-butyl group at the 4-position. This compound has a molecular formula that reflects its cyclic nature and the presence of a ketone functional group. It typically appears as a colorless to pale yellow liquid with a distinctive odor. The presence of the tert-butyl group contributes to its steric bulk, influencing its reactivity and physical properties. 4-tert-Butylcycloheptanone is known for its relatively low volatility and moderate solubility in organic solvents, making it useful in various chemical applications, including as an intermediate in organic synthesis. Its stability under standard conditions allows for its use in research and industrial processes. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, 4-tert-butylcycloheptanone is a notable compound in organic chemistry with specific characteristics that make it of interest in various fields.
Formula:C11H20O
InChI:InChI=1/C11H20O/c1-11(2,3)9-5-4-6-10(12)8-7-9/h9H,4-8H2,1-3H3
SMILES:CC(C)(C)C1CCCC(=O)CC1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-tert-Butylcycloheptan-1-one
CAS:Controlled ProductFormula:C11H20OColor and Shape:NeatMolecular weight:168.2764-tert-Butylcycloheptan-1-one
CAS:<p>4-tert-Butylcycloheptan-1-one is an organic compound that belongs to the group of stereoisomeric compounds. It has been used in the synthesis of amines, and spectra have been recorded for it in dimethylformamide and carbonyl. The reagent can be used to produce deuterated 4-tert-butylcycloheptan-1-one by reacting with lithium carbonate and then adding a deuterium atom. This reagent is also useful for determining conformational changes in carbonyl groups because it is not affected by these changes.</p>Formula:C11H20OPurity:Min. 95%Molecular weight:168.28 g/mol

