CAS 5933-29-9
:1H-Benzotriazole-1-carboxamide
Description:
1H-Benzotriazole-1-carboxamide, with the CAS number 5933-29-9, is an organic compound characterized by its benzotriazole structure, which consists of a fused benzene and triazole ring. This compound typically appears as a white to off-white solid and is known for its solubility in polar solvents such as water and alcohols. It exhibits properties that make it useful as a corrosion inhibitor, particularly in metal protection applications, due to its ability to form stable complexes with metal ions. Additionally, it has applications in the field of photostabilizers and UV absorbers, enhancing the durability of materials exposed to sunlight. The presence of the carboxamide functional group contributes to its reactivity and interaction with various substrates. Overall, 1H-Benzotriazole-1-carboxamide is valued for its chemical stability and effectiveness in various industrial applications, particularly in protecting metals from corrosion and degradation.
Formula:C7H6N4O
InChI:InChI=1S/C7H6N4O/c8-7(12)11-6-4-2-1-3-5(6)9-10-11/h1-4H,(H2,8,12)
InChI key:InChIKey=UUMXWUNNKCQWHS-UHFFFAOYSA-N
SMILES:C(N)(=O)N1C=2C(N=N1)=CC=CC2
Synonyms:- 1-Carbamoyl-1H-benzotriazole
- 1H-1,2,3-Benzotriazole-1-carboxamide
- 1H-Benzotriazole-1-carboxamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
