CAS 5933-32-4
:4-Bromobenzoic acid hydrazide
Description:
4-Bromobenzoic acid hydrazide is an organic compound characterized by the presence of a bromine atom and a hydrazide functional group attached to a benzoic acid structure. Its molecular formula typically includes carbon, hydrogen, nitrogen, and bromine, reflecting its composition. The compound is known for its potential applications in pharmaceuticals and organic synthesis, often serving as an intermediate in the preparation of various bioactive molecules. It exhibits properties such as moderate solubility in polar solvents, which can facilitate its use in chemical reactions. The presence of the bromine atom can enhance its reactivity, making it a useful building block in the synthesis of more complex compounds. Additionally, the hydrazide group can participate in various chemical reactions, including hydrazone formation and coupling reactions. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 4-Bromobenzoic acid hydrazide is a versatile compound with significant relevance in chemical research and development.
Formula:C7H7BrN2O
InChI:InChI=1S/C7H7BrN2O/c8-6-3-1-5(2-4-6)7(11)10-9/h1-4H,9H2,(H,10,11)
InChI key:InChIKey=UYIMBYKIIMYFPS-UHFFFAOYSA-N
SMILES:C(NN)(=O)C1=CC=C(Br)C=C1
Synonyms:- (4-Bromobenzoyl)hydrazine
- (p-Bromobenzoyl)hydrazine
- 4-Bromobenzenecarboxylic acid hydrazide
- 4-Bromobenzohydrazide
- 4-Bromobenzoic acid hydrazide
- 4-Bromobenzoic hydrazide
- 4-Bromobenzoyl hydrazide
- Benzoic acid, 4-bromo-, hydrazide
- Benzoic acid, p-bromo-, hydrazide
- INHd 16
- NSC 60114
- p-Bromobenzhydrazide
- p-Bromobenzohydrazide
- p-Bromobenzoic acid hydrazide
- p-Bromobenzoic hydrazide
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4-Bromobenzohydrazide
CAS:Formula:C7H7BrN2OPurity:>97.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:215.054-Bromobenzhydrazide, 98+%
CAS:4-Bromobenzoic hydrazide has been used in the preparation of {2-[1-oxo-3-(4-bromophenyl)-2-propenyl]hydrazide}-4-bromobenzoic acid, {2,2?-[1,4-phenylenebis(1-oxo-2-propene-3,1-diyl)]dihydrazide}-p-bromobenzoic acid and substituted period[1,2-a]pyrimidine-2,4(3H)-diones (PPMDO). This Thermo ScientifiFormula:C7H7BrN2OPurity:98+%Color and Shape:Pale cream, Crystals or powder or crystalline powderMolecular weight:215.054-Bromobenzoic hydrazide, min. 98%
CAS:Formula:BrC6H4CONHNH2Purity:min. 98%Color and Shape:White solidMolecular weight:215.054-Bromobenzhydrazide
CAS:4-Bromobenzhydrazide is an organic compound that is used as an analytical reagent. It has antimycobacterial activity and binds to amines, such as those found in human liver tissue. 4-Bromobenzhydrazide has been shown to have significant cytotoxicity against lymphocytes and macrophages, which may be due to its ability to bind with functional groups on the cell surface. The chemical structure of 4-bromobenzhydrazide is a benzohydrazide derivative in which one hydrogen atom has been replaced by a bromine atom. This replacement results in the formation of a covalent bond between the bromine and the adjacent carbon atom. The 4-bromobenzhydrazide molecule can exist as two isomers, where one isomer has an oxadiazole group and the other does not. The oxadiazole group is electron deficient, which may explain some of its biological properties.Formula:C7H7BrN2OPurity:Min. 95%Color and Shape:PowderMolecular weight:215.05 g/mol4-Bromobenzoic hydrazide
CAS:Formula:BrC6H4CONHNH2Purity:98.0 min. %Color and Shape:White solidMolecular weight:215.05







