CAS 5933-35-7
:N-(2-Nitrophenyl)anthranilic acid
Description:
N-(2-Nitrophenyl)anthranilic acid, with the CAS number 5933-35-7, is an organic compound characterized by its structure, which includes an anthranilic acid moiety substituted with a nitrophenyl group. This compound typically appears as a solid and is known for its potential applications in various fields, including pharmaceuticals and organic synthesis. The presence of the nitro group introduces both electron-withdrawing characteristics and potential reactivity, influencing the compound's chemical behavior and interactions. N-(2-Nitrophenyl)anthranilic acid may exhibit properties such as solubility in organic solvents, while its solubility in water can vary depending on pH. The compound's functional groups allow for participation in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, it may possess biological activity, making it of interest in medicinal chemistry. Safety data should be consulted, as nitro compounds can have specific hazards associated with them, including toxicity and environmental impact.
Formula:C13H10N2O4
InChI:InChI=1S/C13H10N2O4/c16-13(17)9-5-1-2-6-10(9)14-11-7-3-4-8-12(11)15(18)19/h1-8,14H,(H,16,17)
InChI key:InChIKey=FJNZXTAFUISVCI-UHFFFAOYSA-N
SMILES:N(C1=C(C(O)=O)C=CC=C1)C2=C(N(=O)=O)C=CC=C2
Synonyms:- Anthranilic acid, N-(o-nitrophenyl)-
- Benzoic acid, 2-[(2-nitrophenyl)amino]-
- N-(2-Nitrophenyl)anthranilic acid
- 2-[(2-Nitrophenyl)amino]benzoic acid
- N-(o-Nitrophenyl)anthranilic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
