CAS 59361-08-9
:methyl 5-acetamido-4-acetoxy-2-(4-methyl-2-oxo-chromen-7-yl)oxy-6-[(1S,2R)-1,2,3-triacetoxypropyl]tetrahydropyran-2-carboxylate
Description:
Methyl 5-acetamido-4-acetoxy-2-(4-methyl-2-oxo-chromen-7-yl)oxy-6-[(1S,2R)-1,2,3-triacetoxypropyl]tetrahydropyran-2-carboxylate, with CAS number 59361-08-9, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as acetyl, methoxy, and carboxylate moieties. This compound features a tetrahydropyran ring, which contributes to its cyclic nature, and a chromenyl group that may impart specific biological activities or interactions. The presence of acetoxy groups suggests potential reactivity and solubility in organic solvents, while the methoxy group can enhance its lipophilicity. The stereochemistry indicated by the (1S,2R) configuration suggests specific spatial arrangements that could influence its biological activity and interactions with other molecules. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its complex structure and functional diversity could lead to various applications in pharmaceuticals or as a synthetic intermediate in organic synthesis.
Formula:C30H35NO15
InChI:InChI=1/C30H35NO15/c1-14-10-25(37)44-22-11-20(8-9-21(14)22)45-30(29(38)39-7)12-23(41-17(4)34)26(31-15(2)32)28(46-30)27(43-19(6)36)24(42-18(5)35)13-40-16(3)33/h8-11,23-24,26-28H,12-13H2,1-7H3,(H,31,32)/t23?,24-,26?,27-,28?,30?/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
4-Methylumbelliferyl a-D-N-acetyl-4,7,8,9-tetra-O-acetylneuraminic acid methyl ester
CAS:Molecular weight:649.604-Methylumbelliferyl N-acetyl-4,7,8,9-tetra-O-acetyl-a-D-neuraminic acid methyl ester
CAS:<p>4-Methylumbelliferyl N-acetyl-4,7,8,9-tetra-O-acetyl-a-D-neuraminic acid methyl ester (4MU) is a chemiluminescence substrate. It is used in the detection of an enzyme involved in the synthesis of glycoproteins and glycolipids. The enzyme conjugates 4MU with a sugar molecule to form a fluorescent product. This product can be detected by its emission of light at 560 nm when illuminated with light at 450 nm.</p>Purity:Min. 95%Molecular weight:649.6 g/mol

