CAS 59365-60-5
:1-(2-chlorophenyl)ethane-1,2-diol
Description:
1-(2-Chlorophenyl)ethane-1,2-diol, with the CAS number 59365-60-5, is an organic compound characterized by the presence of a chlorophenyl group attached to a diol structure. This compound features two hydroxyl (-OH) groups located on adjacent carbon atoms of an ethane backbone, which contributes to its reactivity and solubility in polar solvents. The chlorophenyl moiety enhances its hydrophobic characteristics while also introducing potential for electrophilic substitution reactions due to the electron-withdrawing nature of the chlorine atom. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Additionally, the presence of functional groups suggests potential for hydrogen bonding, influencing its interactions in various chemical environments. Safety data should be consulted for handling and storage, as compounds with halogen substituents can pose health risks. Overall, 1-(2-chlorophenyl)ethane-1,2-diol is a versatile compound with applications in organic synthesis and medicinal chemistry.
Formula:C8H9ClO2
InChI:InChI=1/C8H9ClO2/c9-7-4-2-1-3-6(7)8(11)5-10/h1-4,8,10-11H,5H2
SMILES:c1ccc(c(c1)C(CO)O)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
