CAS 59378-87-9

PYRROLIDINE-3-CARBOXYLIC ACID

Description:

Pyrrolidine-3-carboxylic acid, also known as proline, is a five-membered cyclic amino acid characterized by its unique structure that includes a pyrrolidine ring with a carboxylic acid functional group. This compound is a non-essential amino acid, meaning it can be synthesized by the body and is not required in the diet. It plays a crucial role in protein synthesis and is involved in various metabolic processes. Pyrrolidine-3-carboxylic acid is known for its ability to stabilize protein structures due to its distinctive cyclic nature, which introduces rigidity and influences the conformation of polypeptides. It is also a precursor for the synthesis of other amino acids and bioactive compounds. The substance is typically a white crystalline solid and is soluble in water, making it suitable for various biochemical applications. Its CAS number, 59378-87-9, is used for identification in chemical databases and regulatory contexts. Overall, pyrrolidine-3-carboxylic acid is significant in both biological systems and synthetic chemistry.

Formula: C₅H₉NO₂

InChI: InChI=1/C5H9NO2/c7-5(8)4-1-2-6-3-4/h4,6H,1-3H2,(H,7,8)

SMILES: C1CNCC1C(=O)O

Synonyms:

• Beta-Proline
• 3-Pyrrolidinecarboxylic acid
• 3-Pyrrolidine Carboxylic Acid

pyrrolidine-3-carboxylic acid

CAS: 59378-87-9

Formula: C₅H₉NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 115.1305

Ref: IN-DA003JWD

3-Pyrrolidine carboxylic acid

CAS: 59378-87-9

3-Pyrrolidine carboxylic acid

Purity: 95

Molecular weight: 115.13g/mol

Ref: 54-OR301045

Pyrrolidine-3-carboxylic acid

CAS: 59378-87-9

Formula: C₅H₉NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 115.132

Ref: 10-F093908

Pyrrolidine-3-carboxylic acid

Controlled Product

CAS: 59378-87-9

Applications Pyrrolidine-3-carboxylic acid (cas# 59378-87-9) is a useful research chemical.

Formula: C₅H₉NO₂

Color and Shape: Neat

Molecular weight: 115.13

Ref: TR-P999948