CAS 59388-58-8: 1,2,3,4-Tetrahydro-2,2,4,7-tetramethylquinoline
Description:1,2,3,4-Tetrahydro-2,2,4,7-tetramethylquinoline, with the CAS number 59388-58-8, is a bicyclic organic compound belonging to the quinoline family. It features a saturated tetrahydroquinoline structure, which contributes to its unique chemical properties. This compound is characterized by its four methyl groups, which enhance its hydrophobicity and influence its reactivity. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The presence of the nitrogen atom in the quinoline ring imparts basic properties, allowing it to participate in various chemical reactions, including electrophilic substitutions. Additionally, its structure may exhibit chirality, leading to potential stereoisomers. This compound is of interest in various fields, including organic synthesis and materials science, due to its potential applications in pharmaceuticals and as a precursor for other chemical compounds. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C13H19N
InChI:InChI=1S/C13H19N/c1-9-5-6-11-10(2)8-13(3,4)14-12(11)7-9/h5-7,10,14H,8H2,1-4H3
InChI key:InChIKey=NRWNXIXJZMSDAU-UHFFFAOYSA-N
SMILES:C=1C=C2C(=CC1C)NC(C)(C)CC2C
- Synonyms:
- 1,2,3,4-Tetrahydro-2,2,4,7-tetramethylquinoline
- 2,2,4,7-Tetramethyl-3,4-dihydro-1H-quinoline
- Quinoline, 1,2,3,4-tetrahydro-2,2,4,7-tetramethyl-
- 2,2,4,7-Tetramethyl-1,2,3,4-tetrahydroquinoline
