
CAS 5939-57-1
:Cucurbitacin F
Description:
Cucurbitacin F is a triterpenoid compound belonging to the cucurbitacin family, which is primarily derived from various plants in the Cucurbitaceae family, such as cucumbers and gourds. It is known for its bitter taste and has been studied for its potential pharmacological properties, including anti-cancer, anti-inflammatory, and anti-diabetic effects. The molecular structure of Cucurbitacin F features a complex tetracyclic framework, which contributes to its biological activity. This compound exhibits cytotoxicity against various cancer cell lines, making it a subject of interest in cancer research. Additionally, Cucurbitacin F has been noted for its ability to inhibit certain signaling pathways involved in cell proliferation and survival. Its solubility characteristics can vary, and it is typically extracted using organic solvents. Due to its potent biological effects, it is important to handle Cucurbitacin F with care in laboratory settings, as it may pose health risks if ingested or improperly handled. Further research continues to explore its mechanisms of action and potential therapeutic applications.
Formula:C30H46O7
InChI:InChI=1S/C30H46O7/c1-25(2,36)12-11-21(33)30(8,37)23-19(32)14-27(5)20-10-9-16-17(13-18(31)24(35)26(16,3)4)29(20,7)22(34)15-28(23,27)6/h9,11-12,17-20,23-24,31-32,35-37H,10,13-15H2,1-8H3/b12-11+/t17-,18+,19-,20+,23+,24-,27+,28-,29+,30+/m1/s1
InChI key:InChIKey=AOHIGMQGPFTKQX-QZPKXHNASA-N
SMILES:C[C@]12[C@@](C)([C@@]([C@@](C(/C=C/C(C)(C)O)=O)(C)O)([C@H](O)C1)[H])CC(=O)[C@]3(C)[C@]2(CC=C4[C@]3(C[C@H](O)[C@@H](O)C4(C)C)[H])[H]
Synonyms:- NSC 251680
- (2β,3α,9β,10α,16α,23E)-2,3,16,20,25-Pentahydroxy-9-methyl-19-norlanosta-5,23-diene-11,22-dione
- Cucurbitacin F
- Cucurbitacine F
- 19-Norlanosta-5,23-diene-11,22-dione, 2,3,16,20,25-pentahydroxy-9-methyl-, (2β,3α,9β,10α,16α,23E)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cucurbitacin F
CAS:Cucurbitacin F is a useful organic compound for research related to life sciences. The catalog number is T124590 and the CAS number is 5939-57-1.Formula:C30H46O7Color and Shape:SolidMolecular weight:518.691
