CAS 594-73-0
:hexabromoethane
Description:
Hexabromoethane, with the CAS number 594-73-0, is a brominated organic compound characterized by its molecular formula C2Br6. It appears as a colorless to pale yellow solid and is known for its high density and low solubility in water. Hexabromoethane is primarily used as a flame retardant and in various industrial applications due to its ability to inhibit combustion. The compound is stable under normal conditions but can decompose when exposed to high temperatures, releasing toxic bromine-containing gases. Its structure consists of a central ethane backbone with six bromine atoms attached, which significantly alters its physical and chemical properties compared to non-brominated hydrocarbons. Hexabromoethane is also of interest in research related to environmental chemistry and toxicology, as the persistence of brominated compounds in the environment raises concerns regarding their potential ecological and health impacts. Proper handling and disposal are essential due to its hazardous nature.
Formula:C2Br6
InChI:InChI=1/C2Br6/c3-1(4,5)2(6,7)8
SMILES:C(C(Br)(Br)Br)(Br)(Br)Br
Synonyms:- Ethane, 1,1,1,2,2,2-Hexabromo-
- Ethane, hexabromo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Hexabromoethane
CAS:<p>Hexabromoethane is a metal chelate that has been shown to activate the polymerization of cyclohexane rings. It is often used as a light-sensitive initiator for the production of polymers, such as polyethylene. Hexabromoethane can also be found in some halogenated compounds and hydroxyl groups. The molecule is made up of six bromine atoms, an ethane chain, and one hydrogen atom. Hexabromoethane has significant interactions with other functional groups, including hydroxyls and monomers.</p>Formula:C2Br6Purity:Min. 95%Color and Shape:PowderMolecular weight:503.45 g/mol
