CAS 59411-15-3

1-(3,4-dimethylphenyl)-2-phenylethane-1,2-dione

Description:

1-(3,4-Dimethylphenyl)-2-phenylethane-1,2-dione, also known by its CAS number 59411-15-3, is an organic compound characterized by its diketone structure, featuring two carbonyl (C=O) groups. This compound is a derivative of phenyl and exhibits a complex aromatic system due to the presence of multiple phenyl groups and methyl substituents. The presence of the dimethyl groups on the aromatic ring contributes to its hydrophobic nature and can influence its reactivity and solubility in organic solvents. Typically, diketones like this one can participate in various chemical reactions, including condensation and oxidation, making them valuable in synthetic organic chemistry. The compound may also exhibit interesting biological activities, although specific studies would be required to elucidate its potential applications in pharmaceuticals or materials science. Its physical properties, such as melting point, boiling point, and spectral characteristics, would be essential for further characterization and practical applications.

Formula: C₁₆H₁₄O₂

InChI: InChI=1/C16H14O2/c1-11-8-9-14(10-12(11)2)16(18)15(17)13-6-4-3-5-7-13/h3-10H,1-2H3

SMILES: Cc1ccc(cc1C)C(=O)C(=O)c1ccccc1

Synonyms:

• 1,2-Ethanedione, 1-(3,4-Dimethylphenyl)-2-Phenyl-

1-(3,4-Dimethylphenyl)-2-phenylethane-1,2-dione

CAS: 59411-15-3

Formula: C₁₆H₁₄O₂

Molecular weight: 238.2812

Ref: IN-DA00EIWK

1-(3,4-Dimethylphenyl)-2-phenylethane-1,2-dione

CAS: 59411-15-3

Versatile small molecule scaffold

Formula: C₁₆H₁₄O₂

Purity: Min. 95%

Molecular weight: 238.28 g/mol

Ref: 3D-JCA41115