CAS 59413-14-8

1-(3-hydroxypropyl)-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione

Description:

1-(3-hydroxypropyl)-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione, commonly known as a derivative of the purine class of compounds, exhibits several notable characteristics. This compound features a purine backbone, which is characterized by a fused double-ring structure containing nitrogen atoms. The presence of the hydroxypropyl group contributes to its solubility and potential biological activity, while the dimethyl substitutions at the 3 and 7 positions can influence its pharmacological properties. Typically, compounds of this nature may exhibit stimulant effects, similar to caffeine, due to their structural similarities. The molecular structure suggests potential interactions with adenosine receptors, which are crucial in various physiological processes. Additionally, the compound may possess antioxidant properties, making it of interest in biochemical research. Its CAS number, 59413-14-8, allows for easy identification in chemical databases, facilitating further studies on its synthesis, reactivity, and applications in medicinal chemistry or as a potential therapeutic agent.

Formula: C₁₀H₁₄N₄O₃

InChI: InChI=1/C10H14N4O3/c1-12-6-11-8-7(12)9(16)14(4-3-5-15)10(17)13(8)2/h6,15H,3-5H2,1-2H3

SMILES: Cn1cnc2c1c(=O)n(CCCO)c(=O)n2C

Synonyms:

• 3,7-Dihydro-1-(3-hydroxypropyl)-3,7-dimethyl-1H-purine-2,6-dione (9CI)

1-(3-Hydroxypropyl)-3,7-dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione

CAS: 59413-14-8

1-(3-Hydroxypropyl)-3,7-dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione

Purity: 95%

Molecular weight: 238.25g/mol

Ref: 54-OR1002782

Pentoxifylline EP Impurity D

CAS: 59413-14-8

Formula: C₁₀H₁₄N₄O₃

Color and Shape: White To Off-White Solid

Molecular weight: 238.25

Ref: 4Z-P-058

Pentoxifylline EP Impurity D

CAS: 59413-14-8

Formula: C₁₀H₁₄N₄O₃

Molecular weight: 238.24

Ref: ST-EA-CP-P17004

1-(3-Hydroxypropyl)theobromine

Controlled Product

CAS: 59413-14-8

Formula: C₁₀H₁₄N₄O₃

Color and Shape: White To Off-White

Molecular weight: 238.243

Ref: TR-H996370

1-(3-Hydroxypropyl)-3,7-dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione

CAS: 59413-14-8

Purity: 98%

Molecular weight: 238.246994

Ref: 10-F958983

1-(3-Hydroxypropyl)-3,7-dimethylpurine-2,6-dione

Controlled Product

CAS: 59413-14-8

1-(3-Hydroxypropyl)-3,7-dimethylpurine-2,6-dione (1,7-dimethylxanthine) is a methylxanthine that stimulates the heart and respiratory system. It can be used to dilute oral pharmaceutical preparations or to prepare injectable solutions. 1,7-Dimethylxanthine has been shown to have inotropic effects and is able to stimulate protein synthesis. It also inhibits the breakdown of adenosine by phosphodiesterase and blocks the activity of phosphodiesterases IIA and III. This agent also has bronchodilatory properties which may be due to its ability to inhibit phosphodiesterase IV.

Formula: C₁₀H₁₄N₄O₃

Purity: Min. 95%

Molecular weight: 238.24 g/mol

Ref: 3D-FH171969