CAS 59413-14-8
:1-(3-hydroxypropyl)-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione
Description:
1-(3-hydroxypropyl)-3,7-dimethyl-3,7-dihydro-1H-purine-2,6-dione, commonly known as a derivative of the purine class of compounds, exhibits several notable characteristics. This compound features a purine backbone, which is characterized by a fused double-ring structure containing nitrogen atoms. The presence of the hydroxypropyl group contributes to its solubility and potential biological activity, while the dimethyl substitutions at the 3 and 7 positions can influence its pharmacological properties. Typically, compounds of this nature may exhibit stimulant effects, similar to caffeine, due to their structural similarities. The molecular structure suggests potential interactions with adenosine receptors, which are crucial in various physiological processes. Additionally, the compound may possess antioxidant properties, making it of interest in biochemical research. Its CAS number, 59413-14-8, allows for easy identification in chemical databases, facilitating further studies on its synthesis, reactivity, and applications in medicinal chemistry or as a potential therapeutic agent.
Formula:C10H14N4O3
InChI:InChI=1/C10H14N4O3/c1-12-6-11-8-7(12)9(16)14(4-3-5-15)10(17)13(8)2/h6,15H,3-5H2,1-2H3
SMILES:Cn1cnc2c1c(=O)n(CCCO)c(=O)n2C
Synonyms:- 3,7-Dihydro-1-(3-hydroxypropyl)-3,7-dimethyl-1H-purine-2,6-dione (9CI)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1-(3-Hydroxypropyl)-3,7-dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione
CAS:1-(3-Hydroxypropyl)-3,7-dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dionePurity:95%Molecular weight:238.25g/molPentoxifylline EP Impurity D
CAS:Formula:C10H14N4O3Color and Shape:White To Off-White SolidMolecular weight:238.251-(3-Hydroxypropyl)-3,7-dimethyl-2,3,6,7-tetrahydro-1H-purine-2,6-dione
CAS:Purity:98%Molecular weight:238.2469941-(3-Hydroxypropyl)theobromine
CAS:Controlled ProductFormula:C10H14N4O3Color and Shape:White To Off-WhiteMolecular weight:238.2431-(3-Hydroxypropyl)-3,7-dimethylpurine-2,6-dione
CAS:Controlled Product1-(3-Hydroxypropyl)-3,7-dimethylpurine-2,6-dione (1,7-dimethylxanthine) is a methylxanthine that stimulates the heart and respiratory system. It can be used to dilute oral pharmaceutical preparations or to prepare injectable solutions. 1,7-Dimethylxanthine has been shown to have inotropic effects and is able to stimulate protein synthesis. It also inhibits the breakdown of adenosine by phosphodiesterase and blocks the activity of phosphodiesterases IIA and III. This agent also has bronchodilatory properties which may be due to its ability to inhibit phosphodiesterase IV.Formula:C10H14N4O3Purity:Min. 95%Molecular weight:238.24 g/mol





