CAS 5942-25-6

Formula: C10H13NO4

InChI: InChI=1S/C10H13NO4/c1-15-9-6-7(2-3-8(9)13)10(14)11-4-5-12/h2-3,6,12-13H,4-5H2,1H3,(H,11,14)

InChI key: JDMYVMZSGKUWLR-UHFFFAOYSA-N

SMILES: COC1=C(C=CC(=C1)C(=O)NCCO)O

Bryonamide B

CAS: 5942-25-6

Ref: IN-DA01V38F

Bryonamide B

CAS: 5942-25-6

Bryonamide B

Formula: C₁₀H₁₃NO₄

Purity: ≥98%

Molecular weight: 211.21

Ref: 54-BUP07323

Bryonamide B

CAS: 5942-25-6

Formula: C₁₀H₁₃NO₄

Molecular weight: 211.22

Ref: 7W-GY3900

Bryonamide B

CAS: 5942-25-6

Bryonamide B is a cucurbitane triterpene that can be extracted from Bryonia aspera.

Formula: C₁₀H₁₃NO₄

Purity: 99.97%

Color and Shape: White Solid

Molecular weight: 211.21

Ref: TM-TN1457

Bryonamide B

CAS: 5942-25-6

Formula: C₁₀H₁₃NO₄

Purity: 95%~99%

Molecular weight: 211.217

Ref: BP-BP4418

Bryonamide B

CAS: 5942-25-6

Bryonamide B is a cyclic peptide that acts as a cytotoxic compound, which is derived from marine cyanobacteria, specifically within the order Nostocales. This compound is produced through the secondary metabolic processes of these microorganisms, highlighting its natural origin and the complex biosynthesis pathways involved. Marine cyanobacteria are renowned for their ability to produce a plethora of bioactive substances with diverse biological activities.

Formula: C₁₀H₁₃NO₄

Purity: Min. 95%

Molecular weight: 211.21 g/mol

Ref: 3D-FAA94225