CAS 5945-45-9
:Miliacin
Description:
Miliacin, with the CAS number 5945-45-9, is a chemical compound classified as a triterpenoid saponin. It is primarily derived from the plant species *Miliusa* and is known for its potential pharmacological properties. Miliacin exhibits a range of biological activities, including anti-inflammatory, antimicrobial, and cytotoxic effects, making it of interest in medicinal chemistry and pharmacology. The compound is characterized by its complex molecular structure, which includes multiple rings and functional groups typical of saponins, contributing to its bioactivity. Miliacin's solubility properties can vary, often being more soluble in organic solvents than in water, which is a common trait among saponins. Additionally, its safety profile and potential therapeutic applications are subjects of ongoing research, particularly in the context of traditional medicine and natural product chemistry. Overall, miliacin represents a significant area of study for its potential health benefits and applications in drug development.
Formula:C31H52O
InChI:InChI=1S/C31H52O/c1-26(2)16-17-28(5)18-19-30(7)21(22(28)20-26)10-11-24-29(6)14-13-25(32-9)27(3,4)23(29)12-15-31(24,30)8/h20-21,23-25H,10-19H2,1-9H3/t21-,23+,24-,25+,28-,29+,30-,31-/m1/s1
InChI key:InChIKey=YZBNXQLCEJJXSC-LZBBLKFASA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)(C(C)(C)[C@@H](OC)CC3)[H])(CC[C@]4([C@@]2(C)CC[C@]5(C)C4=CC(C)(C)CC5)[H])[H]
Synonyms:- (3β)-3-Methoxyolean-18-ene
- Miliacin
- Olean-18-ene, 3-methoxy-, (3β)-
- Olean-18-ene, 3β-methoxy-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Miliacin
CAS:Miliacin is a natural product discovered in millet that enhances metabolic and proliferative capacity in human epidermal keratinocytes.Formula:C31H52OPurity:99.99%Color and Shape:SoildMolecular weight:440.74Miliacin
CAS:Alicyclic etherFormula:C31H52OPurity:≥ 98.0 % (GC)Color and Shape:PowderMolecular weight:440.76Miliacin
CAS:Controlled ProductMiliacin is a growth factor that is produced by the bacterium Lactobacillus acidophilus. It has been shown to inhibit the growth of bacteria and fungi, but not viruses. Miliacin is active against gram-positive and gram-negative bacteria, such as Enterococcus faecalis and Escherichia coli. It also has an inhibitory effect on radiation induced damage in cultured cells. Miliacin has been shown to be effective in animal models of inflammatory diseases such as insulin resistance, arthritis and asthma. The natural triterpenoid miliacin is responsible for these effects.
Formula:C31H52OPurity:Min. 95%Color and Shape:PowderMolecular weight:440.74 g/molRef: 3D-FAA94545
Discontinued product


