CAS 59454-35-2: 4-Decyl-4′-cyanobiphenyl

Description:4-Decyl-4′-cyanobiphenyl, commonly referred to as a cyanobiphenyl compound, is a member of the liquid crystal family, specifically used in the formulation of liquid crystal displays (LCDs). This compound features a biphenyl structure with a decyl chain and a cyano group, which contribute to its unique properties. The presence of the long alkyl chain enhances the solubility and fluidity of the liquid crystal phase, while the cyano group introduces polar characteristics, influencing the alignment and electro-optical properties of the material. Typically, this compound exhibits a mesogenic behavior, allowing it to transition between different phases, such as nematic or smectic, depending on temperature. Its thermal stability and ability to respond to electric fields make it suitable for various applications in display technologies. Additionally, the molecular structure allows for tunable properties, which can be optimized for specific applications in the field of optoelectronics. Overall, 4-Decyl-4′-cyanobiphenyl is significant in advancing liquid crystal technology.

Formula:C₂₃H₂₉N

InChI:InChI=1S/C23H29N/c1-2-3-4-5-6-7-8-9-10-20-11-15-22(16-12-20)23-17-13-21(19-24)14-18-23/h11-18H,2-10H2,1H3

InChI key:InChIKey=GLGZJMAYDWXROS-UHFFFAOYSA-N

SMILES:N#CC=1C=CC(=CC1)C2=CC=C(C=C2)CCCCCCCCCC

Synonyms:
(1,1'-Biphenyl)-4-carbonitrile, 4'-decyl-
4'-Decyl-4'-Cyanobiphenyl
4'-Decylbiphenyl-4-Carbonitrile
4-Cyano-4'-decylbiphenyl
4-n-Decyl-4′-cyanobiphenyl
CB 10 (liquid crystal)
Cb 10
K 30 (liquid crystal)
4′-Decyl[1,1′-biphenyl]-4-carbonitrile

Found 4 products.

Product data	Purity	Price range	Estimated delivery
10CB REF: IN-DA00EARDCAS: 59454-35-2	97%	To inquire	Mon 14 Apr 25
4-Cyano-4'-decylbiphenyl REF: 3B-C3238CAS: 59454-35-2	>98.0%(GC)	78.00 €~269.00 €	Thu 17 Apr 25
4-Cyano-4'-decylbiphenyl REF: 10-F049326CAS: 59454-35-2	95.0%	To inquire	Thu 24 Apr 25
4'-Decyl-[1,1'-biphenyl]-4-carbonitrile REF: 3D-FD155268CAS: 59454-35-2	Min. 95%	- - -	Discontinued product