CAS 59456-70-1

Nikkomycin Z

Description:

Nikkomycin Z is a naturally occurring antibiotic that belongs to the class of compounds known as nucleoside antibiotics. It is primarily derived from the fermentation of certain species of Streptomyces bacteria. This compound exhibits potent antifungal activity, particularly against various species of fungi, including those that cause infections in humans. Nikkomycin Z functions by inhibiting chitin synthesis, which is crucial for fungal cell wall integrity, thereby leading to cell death. The chemical structure of Nikkomycin Z features a unique bicyclic core that contributes to its biological activity. It is characterized by its relatively low toxicity to mammalian cells, making it a candidate for therapeutic applications. Additionally, Nikkomycin Z has been studied for its potential use in treating fungal infections, particularly in immunocompromised patients. Its effectiveness and mechanism of action continue to be subjects of research, highlighting its significance in the field of medicinal chemistry and pharmacology.

Formula: C₂₀H₂₅N₅O₁₀

InChI: InChI=1S/C20H25N5O10/c1-7(13(28)9-3-2-8(26)6-22-9)11(21)17(31)24-12(19(32)33)16-14(29)15(30)18(35-16)25-5-4-10(27)23-20(25)34/h2-7,11-16,18,26,28-30H,21H2,1H3,(H,24,31)(H,32,33)(H,23,27,34)/t7-,11-,12-,13-,14-,15+,16+,18+/m0/s1

InChI key: InChIKey=WWJFFVUVFNBJTN-VHDFTHOZSA-N

SMILES: O[C@H]1[C@@H](O[C@]([C@H](NC([C@H]([C@@H]([C@H](O)C2=CC=C(O)C=N2)C)N)=O)C(O)=O)([C@H]1O)[H])N3C(=O)NC(=O)C=C3

Synonyms:

• β-D-Allofuranuronic acid, 5-[[(2S,3S,4S)-2-amino-4-hydroxy-4-(5-hydroxy-2-pyridinyl)-3-methyl-1-oxobutyl]amino]-1,5-dideoxy-1-(3,4-dihydro-2,4-dioxo-1(2H)-pyrimidinyl)-
• 5-[[(2S,3S,4S)-2-Amino-4-hydroxy-4-(5-hydroxy-2-pyridinyl)-3-methyl-1-oxobutyl]amino]-1,5-dideoxy-1-(3,4-dihydro-2,4-dioxo-1(2H)-pyrimidinyl)-β-D-allofuranuronic acid
• Nikkomycin Z
• β-D-Allofuranuronic acid, 5-[[2-amino-4-hydroxy-4-(5-hydroxy-2-pyridinyl)-3-methyl-1-oxobutyl]amino]-1,5-dideoxy-1-(3,4-dihydro-2,4-dioxo-1(2H)-pyrimidinyl)-, [2S-(2R*,3R*,4R*)]-
• Neopolyoxin C

Nikkomycin Z

CAS: 59456-70-1

Formula: C₂₀H₂₅N₅O₁₀

Purity: 90%

Color and Shape: Solid

Molecular weight: 495.4400

Ref: IN-DA00EBHG

Nikkomycin Z from streptomyces tendae

CAS: 59456-70-1

Nikkomycin Z is an antifungal agent, which is a secondary metabolite isolated from the bacterium Streptomyces tendae. This compound functions as a competitive inhibitor of chitin synthase, an essential enzyme responsible for the synthesis of chitin, a vital component of the fungal cell wall. By inhibiting this enzyme, Nikkomycin Z disrupts the structural integrity of the fungal cell wall, leading to impaired growth and cell lysis in susceptible fungi.

Formula: C₂₀H₂₅N₅O₁₀

Purity: Min. 95%

Molecular weight: 495.4 g/mol

Ref: 3D-JCA45670

Nikkomycin Z

CAS: 59456-70-1

Nikkomycin Z (Nikkomycin Z from Streptomyces tendae) is a competitive chitin synthase inhibitor.It inhibitor of the growth of filamentous fungi, insects,

Formula: C₂₀H₂₅N₅O₁₀

Purity: 98%

Color and Shape: Solid

Molecular weight: 495.44

Ref: TM-T8814