CAS 59464-18-5
:(1S)-1,4-anhydro-1-(4-oxo-2-thioxo-1,2,3,4-tetrahydropyrimidin-5-yl)-D-ribitol
Description:
(1S)-1,4-Anhydro-1-(4-oxo-2-thioxo-1,2,3,4-tetrahydropyrimidin-5-yl)-D-ribitol, with CAS number 59464-18-5, is a chemical compound that features a complex structure combining a ribitol moiety with a tetrahydropyrimidine derivative. This compound is characterized by its anhydro sugar framework, which indicates the absence of a hydroxyl group typically found in sugar alcohols. The presence of a thioxo group and a keto group in the tetrahydropyrimidine ring contributes to its potential reactivity and biological activity. The stereochemistry at the anhydro position is specified as (1S), indicating a specific spatial arrangement of atoms that can influence the compound's interactions in biological systems. Such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry and drug development. Additionally, the presence of sulfur in the thioxo group may impart unique chemical properties, such as increased nucleophilicity or altered solubility profiles. Overall, this compound represents a unique intersection of carbohydrate chemistry and heterocyclic chemistry.
Formula:C9H12N2O5S
InChI:InChI=1/C9H12N2O5S/c12-2-4-5(13)6(14)7(16-4)3-1-10-9(17)11-8(3)15/h1,4-7,12-14H,2H2,(H2,10,11,15,17)/t4-,5-,6-,7+/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Thiopseudouridine
CAS:Nucleoside Derivatives - C-nucleosides; Thio-nucleosidesFormula:C9H12N2O5SColor and Shape:SolidMolecular weight:260.27Ref: TM-TNU0734
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire2-Thiopseudouridine
CAS:2-Thiopseudouridine is a heterocyclic nucleoside that is used as a building block for the synthesis of natural products. 2-Thiopseudouridine is prepared by a two-step process involving the desymmetrization of pseudoisocytidine and the formation of an aminopyrimidinone. The desymmetrization reaction proceeds with high stereoselectivity to yield the desired product in high yields. Other carbocyclic nucleosides can be synthesized from 2-thiopseudouridine, such as 2-thienopyrrole and 2-pyrroline.Formula:C9H12N2O5SPurity:Min. 95%Color and Shape:SolidMolecular weight:260.27 g/mol

