CAS 59468-44-9: 8-Chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylic acid
Description:8-Chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylic acid is a chemical compound characterized by its complex structure, which includes a benzodiazepine core fused with an imidazole ring. This compound features a chloro substituent at the 8-position and a fluorophenyl group at the 6-position, contributing to its unique chemical properties and potential biological activity. The presence of a carboxylic acid functional group at the 3-position enhances its solubility in polar solvents and may influence its pharmacological interactions. The compound is of interest in medicinal chemistry, particularly for its potential applications in the development of therapeutic agents targeting various neurological conditions. Its specific interactions with biological targets, such as receptors or enzymes, would depend on its three-dimensional conformation and electronic properties, which are influenced by the substituents on the benzodiazepine framework. As with many such compounds, safety and handling precautions are essential due to potential toxicity and reactivity.
Formula:C19H13ClFN3O2
InChI:InChI=1S/C19H13ClFN3O2/c1-10-23-18(19(25)26)16-9-22-17(12-4-2-3-5-14(12)21)13-8-11(20)6-7-15(13)24(10)16/h2-8H,9H2,1H3,(H,25,26)
InChI key:InChIKey=WZNYKINYEPCGAZ-UHFFFAOYSA-N
SMILES:O=C(O)C=1N=C(N2C=3C=CC(Cl)=CC3C(=NCC12)C=4C=CC=CC4F)C
- Synonyms:
- 4H-Imidazo[1,5-a][1,4]benzodiazepine-3-carboxylic acid, 8-chloro-6-(2-fluorophenyl)-1-methyl-
- 8-Chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepin-3-carboxylic acid
- 8-chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylic acid
- 8-Chloro-6-(o-fluorophenyl)-1-methyl-4H-imidazo(1,5-a)(1,4)benzodiazepine-3-carboxylic acid

8-Chloro-6-(2-fluorophenyl)-1-methyl-4H-imidazo[1,5-a][1,4]benzodiazepine-3-carboxylic Acid
Controlled ProductRef: 86-MM1106.11-0025
25mg | 2,061.00 € |

8-Chloro-6-(2-fluorophenyl)-1-methyl-4H-Imidazo[1,5-a][1,4]benzodiazepine-3-carboxylic Acid
Controlled ProductRef: TR-C366405
25mg | 2,733.00 € | ||
2500µg | 402.00 € |

8-Chloro-6-(O-Fluorophenyl)-1-Methyl-4H-Imidazo[1,5-a][1,4]Benzodiazepine-3-Carboxylic Acid
Controlled ProductRef: 3D-FC101763
1mg | 531.00 € | ||
2mg | 729.00 € | ||
5mg | 1,184.00 € | ||
10mg | 1,961.00 € | ||
25mg | 3,749.00 € |