CAS 59474-01-0

(10-methylanthracen-9-yl)methyl carbamimidothioate

Description:

The chemical substance "(10-methylanthracen-9-yl)methyl carbamimidothioate," with the CAS number 59474-01-0, is a compound that features a complex structure incorporating an anthracene derivative and a carbamimidothioate functional group. This compound is characterized by its aromatic nature due to the anthracene moiety, which contributes to its potential photophysical properties, such as fluorescence. The presence of the carbamimidothioate group suggests that it may exhibit biological activity, possibly as a thiol-reactive agent or in interactions with biological macromolecules. The methyl substitution at the 10-position of the anthracene ring can influence the compound's solubility and reactivity. Additionally, the overall molecular structure may impart specific characteristics such as stability, reactivity, and potential applications in fields like organic synthesis, materials science, or medicinal chemistry. However, detailed studies would be necessary to fully elucidate its properties, including its solubility, melting point, and reactivity under various conditions.

Formula: C₁₇H₁₆N₂S

InChI: InChI=1/C17H16N2S/c1-11-12-6-2-4-8-14(12)16(10-20-17(18)19)15-9-5-3-7-13(11)15/h2-9H,10H2,1H3,(H3,18,19)

SMILES: Cc1c2ccccc2c(CSC(=N)N)c2ccccc12

(10-METHYL-9-ANTHRACENYL) CARBAMIMIDOTHIOIC ACID METHYL ESTER HYDROCHLORIDE

CAS: 59474-01-0

Formula: C₁₇H₁₇ClN₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 316.8483

Ref: IN-DA00EB3X

NSC 146109 hydrochloride

CAS: 59474-01-0

NSC 146109 hydrochloride

Purity: ≥95%

Molecular weight: 316.85g/mol

Ref: 54-BUP16372

S-(10-Methylanthracen-9-yl)methyl Isothiourea Hydrochloride

Controlled Product

CAS: 59474-01-0

Formula: C₁₇H₁₆N₂S·HCl

Color and Shape: Neat

Molecular weight: 316.848

Ref: TR-M288070

NSC 146109 hydrochloride

CAS: 59474-01-0

NSC 146109 is a potent apoptosis inducer that binds to the Bcl-2 family of proteins and inhibits their anti-apoptotic activities. NSC 146109 has been shown to inhibit protease activity and fatty acid synthesis, which are both required for tumor cell growth. It also prevents the inhibition of p21, an inhibitor of cyclin-dependent kinases. In addition, NSC 146109 induces mitochondrial membrane potential and nuclear DNA fragmentation, leading to apoptosis. The mechanism by which it triggers apoptosis is not fully understood; however, it has been suggested that the molecule may interfere with transcriptional regulation in the cell nucleus.

Formula: C₁₇H₁₆N₂S·HCl

Purity: Min. 95%

Molecular weight: 316.85 g/mol

Ref: 3D-JCA47401

NSC 146109 hydrochloride

CAS: 59474-01-0

NSC 146109 hydrochloride is an activator of p53 targeting MDMX. NSC 146109 hydrochloride can be used for studies on breast cancer.

Formula: C₁₇H₁₇ClN₂S

Purity: 99.28%

Color and Shape: Solid

Molecular weight: 316.85

Ref: TM-T12257