CAS 59477-82-6

(2R)-1-(4-tert-butylphenyl)-2-chloropropan-1-one

Description:

(2R)-1-(4-tert-butylphenyl)-2-chloropropan-1-one, with the CAS number 59477-82-6, is an organic compound characterized by its ketone functional group and a chiral center. This compound features a propanone backbone, where a chlorine atom is attached to the second carbon, and a para-substituted tert-butylphenyl group is attached to the first carbon. The presence of the tert-butyl group contributes to its hydrophobic nature, while the chlorine atom enhances its reactivity and potential for further chemical transformations. As a chiral molecule, it can exist in two enantiomeric forms, which may exhibit different biological activities or properties. This compound is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Safety data should be consulted for handling and storage, as it may pose health risks if not managed properly.

Formula: C₁₃H₁₇ClO

InChI: InChI=1/C13H17ClO/c1-9(14)12(15)10-5-7-11(8-6-10)13(2,3)4/h5-9H,1-4H3/t9-/m1/s1

SMILES: C[C@H](C(=O)c1ccc(cc1)C(C)(C)C)Cl

1-(4-tert-Butyl-phenyl)-2-chloro-propan-1-one

CAS: 59477-82-6

Formula: C₁₃H₁₇ClO

Molecular weight: 224.7265

Ref: IN-DA00F2DG

1-(4-tert-Butylphenyl)-2-chloropropan-1-one

CAS: 59477-82-6

Versatile small molecule scaffold

Formula: C₁₃H₁₇ClO

Purity: Min. 95%

Molecular weight: 224.72 g/mol

Ref: 3D-JCA47782