CAS 59481-23-1
:(tyr1)-somatostatin
Description:
Tyr1-somatostatin, identified by the CAS number 59481-23-1, is a synthetic analog of the naturally occurring peptide hormone somatostatin, which plays a crucial role in regulating various physiological processes, including the inhibition of hormone secretion and modulation of neurotransmission. This compound is characterized by its structure, which includes a sequence of amino acids that confer its biological activity. Tyr1-somatostatin is particularly noted for its enhanced stability and potency compared to the native somatostatin, making it a valuable tool in research and potential therapeutic applications. It exhibits a range of biological effects, including the inhibition of growth hormone release and the modulation of insulin and glucagon secretion. The compound is typically administered in a controlled manner due to its peptide nature, which can affect its bioavailability and metabolism. Overall, Tyr1-somatostatin serves as an important subject of study in endocrinology and pharmacology, with implications for treating conditions such as acromegaly and certain types of tumors.
Formula:C82H108N18O20S2
InChI:InChI=1/C82H108N18O20S2/c1-45(102)68-80(117)96-60(37-49-22-10-5-11-23-49)77(114)100-69(46(2)103)81(118)97-63(42-101)78(115)98-65(82(119)120)44-122-121-43-64(89-67(106)41-87-70(107)54(85)34-50-28-30-53(104)31-29-50)79(116)91-56(26-14-16-32-83)71(108)95-62(40-66(86)105)76(113)93-58(35-47-18-6-3-7-19-47)73(110)92-59(36-48-20-8-4-9-21-48)74(111)94-61(39-52-38-51-24-12-13-25-55(51)88-52)75(112)90-57(72(109)99-68)27-15-17-33-84/h3-13,18-25,28-31,38,45-46,54,56-65,68-69,88,101-104H,14-17,26-27,32-37,39-44,83-85H2,1-2H3,(H2,86,105)(H,87,107)(H,89,106)(H,90,112)(H,91,116)(H,92,110)(H,93,113)(H,94,111)(H,95,108)(H,96,117)(H,97,118)(H,98,115)(H,99,109)(H,100,114)(H,119,120)/t45-,46-,54+,56+,57-,58?,59+,60-,61+,62+,63+,64-,65?,68?,69?/m1/s1
Synonyms:- Tyr-Gly-Cys-Lys-Asn-Phe-Phe-Trp-Lys-Thr-Phe-Thr-Ser-Cys
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
[Tyr1]-Somatostatin-14
CAS:[Tyr1]-Somatostatin-14 could binds to SSTR2.Formula:C82H108N18O20S2Molecular weight:1729.99[Tyr1]-Somatostatin
CAS:<p>This product contains disulfide bonds between Cys3-Cys14 can is suitable for use in radioimmunoassays. Somatostatin is a peptide hormone that is produced by the hypothalamus and inhibits the release of growth hormones, insulin, and glucagon. It is widely expressed throughout the body for example in the gastrointestinal (GI) tract, hypothalamus, pancreas and the central nervous system. In the central nervous system somatostatin plays a role in neurotransmission modification and it has also demonstrated to be effective against a number of cancers such as squamous carcinoma.</p>Formula:C82H108N18O20S2Purity:Min. 95%Molecular weight:1,730 g/mol(Tyr¹)-Somatostatin-14
CAS:<p>Bachem ID: 4013817.</p>Formula:C82H108N18O20S2Purity: 97.1%Color and Shape:White LyophilisateMolecular weight:1730.0



