CAS 59481-27-5
:(tyr11)-somatostatin
Description:
(tyr11)-somatostatin, with the CAS number 59481-27-5, is a synthetic analog of the naturally occurring peptide hormone somatostatin, which plays a crucial role in regulating various physiological processes, including the inhibition of hormone secretion and modulation of neurotransmission. This specific variant features a tyrosine residue at the 11th position, which enhances its stability and biological activity compared to the native form. Characteristically, (tyr11)-somatostatin exhibits a high affinity for somatostatin receptors, making it valuable in research and potential therapeutic applications, particularly in oncology and endocrinology. Its structure consists of a chain of amino acids, typically comprising 14 residues, which contributes to its biological function. The compound is often studied for its effects on growth hormone release and its potential use in treating conditions such as acromegaly and certain types of tumors. Additionally, (tyr11)-somatostatin is known for its relatively short half-life in circulation, necessitating careful consideration in drug formulation and delivery methods.
Formula:C76H104N18O20S2
InChI:InChI=1/C76H104N18O20S2/c1-40(79)64(101)81-36-61(100)83-58-38-115-116-39-59(76(113)114)92-72(109)57(37-95)91-75(112)63(42(3)97)94-71(108)54(32-45-24-26-48(98)27-25-45)90-74(111)62(41(2)96)93-66(103)51(23-13-15-29-78)84-69(106)55(34-47-33-46-20-10-11-21-49(46)82-47)88-68(105)53(31-44-18-8-5-9-19-44)86-67(104)52(30-43-16-6-4-7-17-43)87-70(107)56(35-60(80)99)89-65(102)50(85-73(58)110)22-12-14-28-77/h4-11,16-21,24-27,33,40-42,50-59,62-63,82,95-98H,12-15,22-23,28-32,34-39,77-79H2,1-3H3,(H2,80,99)(H,81,101)(H,83,100)(H,84,106)(H,85,110)(H,86,104)(H,87,107)(H,88,105)(H,89,102)(H,90,111)(H,91,112)(H,92,109)(H,93,103)(H,94,108)(H,113,114)/t40-,41+,42+,50-,51+,52?,53-,54+,55-,56?,57-,58+,59-,62?,63?/m0/s1
Synonyms:- Somatostatin, tyr(11)-
- 11-Tyr-somatostatin
- 11-Tyrosine-somatostatin
- Somatostatin, tyrosine(11)-
- Growth hormone-release inhibiting factor (sheep), 11-L-tyrosine-
- [Tyr11 ]-Somatostatin
- Somatostatin (sheep), 11-L-tyrosine- (9CI)
- H-Ala-Gly-Cys-Lys-Asn-Phe-Phe-Trp-Lys-Thr-Tyr-Thr-Ser-Cys-OH, (Disulfide bond)
- tyr(11)-somatostati
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(Tyr¹¹)-Somatostatin-14
CAS:<p>Bachem ID: 4019615.</p>Formula:C76H104N18O20S2Purity:98.6%Color and Shape:White PowderMolecular weight:1653.9[Tyr11]-Somatostatin
CAS:[Tyr11]-Somatostatin, a neuroactive peptide, aids proteomics research and modulates retinal function.Formula:C76H104N18O20S2Molecular weight:1653.89


