CAS 59483-84-0
:Di-pentafluorophenyl carbonate
Description:
Di-pentafluorophenyl carbonate is an organic compound characterized by its carbonate functional group attached to two pentafluorophenyl groups. This substance is notable for its high fluorine content, which imparts unique properties such as increased thermal stability and chemical resistance. The presence of multiple fluorine atoms enhances its hydrophobicity and makes it less reactive compared to non-fluorinated analogs. Di-pentafluorophenyl carbonate is typically used in specialized applications, including as a reagent in organic synthesis and in the development of advanced materials. Its structure contributes to its potential use in pharmaceuticals and agrochemicals, where stability and reactivity are crucial. Additionally, the compound may exhibit low volatility and high density, making it suitable for various industrial applications. Safety considerations are important when handling this compound, as fluorinated compounds can pose environmental and health risks. Overall, di-pentafluorophenyl carbonate is a valuable compound in the field of chemistry, particularly in the synthesis of complex organic molecules.
Formula:C13F10O3
InChI:InChI=1/C13F10O3/c14-1-3(16)7(20)11(8(21)4(1)17)25-13(24)26-12-9(22)5(18)2(15)6(19)10(12)23
SMILES:c1(c(c(c(c(c1F)F)OC(=O)Oc1c(c(c(c(c1F)F)F)F)F)F)F)F
Synonyms:- Bis(pentafluorophenyl)carbonate
- Dpfpc
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Bis(pentafluorophenyl) Carbonate
CAS:Formula:C13F10O3Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:394.12Bis(pentafluorophenyl) carbonate, 98+%
CAS:Bis(pentafluorophenyl) carbonate is a reagent used as a carbonyl equivalent and for various coupling reactions, especially for azapeptides. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to th
Formula:C13F10O3Purity:98+%Molecular weight:394.12Bis(perfluorophenyl)carbonate
CAS:Formula:C13F10O3Purity:98%Color and Shape:SolidMolecular weight:394.1213Bis(pentafluorophenyl)carbonate
CAS:Bis(pentafluorophenyl)carbonate is a carbonate with a reactive hydroxyl group. It is activated by amines and reacts with alkynes to form new bonds. Bis(pentafluorophenyl)carbonate can be used in the synthesis of monoclonal antibodies, which are important for diagnostic purposes. This reagent can also be used in ring-opening reactions, which are efficient methods for the synthesis of butyric acid.Formula:C13F10O3Purity:Min. 99%Color and Shape:White Off-White PowderMolecular weight:394.12 g/molBis(pentafluorophenyl)carbonate
CAS:Formula:C13F10O3Purity:97%Color and Shape:SolidMolecular weight:394.124Bis(pentafluorophenyl) carbonate
CAS:Bis(pentafluorophenyl) carbonateFormula:C13F10O3Purity:98%Color and Shape: white to almost white crystal to powderMolecular weight:394.12133g/mol





