CAS 59495-21-5
:1-(2-deoxy-beta-D-threo-pentofuranosyl)-2-ethoxy-5-methylpyrimidin-4(1H)-one
Description:
1-(2-Deoxy-beta-D-threo-pentofuranosyl)-2-ethoxy-5-methylpyrimidin-4(1H)-one, with the CAS number 59495-21-5, is a nucleoside analog that exhibits structural features characteristic of both sugar and pyrimidine components. This compound consists of a deoxyribose sugar moiety linked to a pyrimidine base, specifically a methyl-substituted pyrimidinone. The presence of the ethoxy group enhances its lipophilicity, potentially influencing its biological activity and membrane permeability. The compound is of interest in medicinal chemistry, particularly for its potential antiviral or anticancer properties, as many nucleoside analogs are designed to interfere with nucleic acid synthesis. Its molecular structure allows for interactions with biological targets, such as enzymes involved in nucleic acid metabolism. Additionally, the stereochemistry of the sugar component plays a crucial role in its biological function, as it can affect binding affinity and specificity. Overall, this compound represents a class of molecules that are valuable in drug development and therapeutic applications.
Formula:C12H18N2O5
InChI:InChI=1/C12H18N2O5/c1-3-18-12-13-11(17)7(2)5-14(12)10-4-8(16)9(6-15)19-10/h5,8-10,15-16H,3-4,6H2,1-2H3/t8-,9-,10-/m1/s1
SMILES:CCOc1nc(=O)c(C)cn1[C@H]1C[C@H]([C@@H](CO)O1)O
Synonyms:- 4(1H)-pyrimidinone, 1-(2-deoxy-beta-D-threo-pentofuranosyl)-2-ethoxy-5-methyl-
- 2-O-Ethylthymidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
O2-Ethylthymidine-d5
CAS:Controlled ProductApplications O2-Ethylthymidine-d5 is labelled O2-Ethylthymidine (E926925) which is a research reagent use in the study of cytotoxic and mutagenic properties of human cells.
References Wu, J., et al.: J. Bio. Chem., 293, 8638 (2018)Formula:C12D5H13N2O5Color and Shape:NeatMolecular weight:275.3122-O-Ethylthymidine
CAS:Controlled ProductFormula:C12H18N2O5Color and Shape:NeatMolecular weight:270.282-O-Ethylthymidine
CAS:2-O-Ethylthymidine is a nucleoside that is used to study the structure and dynamics of DNA. It can be synthesized by reacting 1-β-D-arabinofuranosylbenzene with ethylmercury acetate. 2-O-Ethylthymidine can be used in kinetic studies as it is specific for dna. It has been shown to have a conformational change, which is stabilized by the presence of an aromatic ring such as phenanthrene. This compound was also found to inhibit neuroblastoma cell growth in vitro.
Formula:C12H18N2O5Purity:Min. 95%Color and Shape:PowderMolecular weight:270.28 g/mol


