CAS 595-05-1
:(4bS,5R,10bS,11R)-5,6,11,12-Tetrahydro-13,18-dimethyl-5,10b:11,4b-Bis(iminoethano)dibenzo[c,h][2,6]naphthyridine
Description:
The chemical substance with the name "(4bS,5R,10bS,11R)-5,6,11,12-Tetrahydro-13,18-dimethyl-5,10b:11,4b-Bis(iminoethano)dibenzo[c,h][2,6]naphthyridine" and CAS number 595-05-1 is a complex organic compound characterized by its unique bicyclic structure, which incorporates multiple fused rings and iminoethano groups. This compound exhibits chirality, indicated by its specific stereochemical descriptors, which suggest the presence of multiple stereocenters that contribute to its three-dimensional conformation. The presence of nitrogen atoms in the imino groups enhances its potential for coordination with metal ions, making it of interest in coordination chemistry and catalysis. Additionally, the compound's structure may impart specific electronic properties, influencing its reactivity and interactions with other molecules. Its intricate arrangement of functional groups and stereochemistry can lead to diverse applications in fields such as medicinal chemistry, materials science, and organic synthesis. However, detailed studies on its biological activity, stability, and reactivity would be necessary to fully understand its potential uses and implications in various chemical contexts.
Formula:C22H26N4
InChI:InChI=1S/C22H26N4/c1-25-13-11-22-16-8-4-5-9-17(16)23-19(25)21(22)12-14-26(2)20(22)24-18-10-6-3-7-15(18)21/h3-10,19-20,23-24H,11-14H2,1-2H3/t19-,20-,21-,22-/m1/s1
InChI key:InChIKey=XSYCDVWYEVUDKQ-GXRSIYKFSA-N
SMILES:CN1[C@@]2([C@]34[C@](C=5C(N2)=CC=CC5)([C@](NC=6C3=CC=CC6)(N(C)CC4)[H])CC1)[H]
Synonyms:- (4bS,5R,10bS,11R)-13,18-dimethyl-5,6,11,12-tetrahydro-5,10b:11,4b-di(epiminoethano)dibenzo[c,h][2,6]naphthyridine
- (4bS,5R,10bS,11R)-5,6,11,12-Tetrahydro-13,18-dimethyl-5,10b:11,4b-Bis(iminoethano)dibenzo[c,h][2,6]naphthyridine
- 13,18-Dimethyl-5,6,11,12-Tetrahydro-5,10B:11,4B-Di(Epiminoethano)Dibenzo[C,H][2,6]Naphthyridine
- 5,10b:11,4b-Bis(iminoethano)dibenzo[c,h][2,6]naphthyridine, 5,6,11,12-tetrahydro-13,18-dimethyl-, (4bS,5R,10bS,11R)-
- 5,10b:11,4b-Bis(iminoethano)dibenzo[c,h][2,6]naphthyridine, 5,6,11,12-tetrahydro-13,18-dimethyl-, [4bS-(4bα,5α,10bα,11α)]-
- Nsc 99016
- [4bS-(4bα,5α,10bα,11α)]-5,6,11,12-Tetrahydro-13,18-dimethyl-5,10b:11,4b-bis(iminoethano)dibenzo[c,h][2,6]naphthyridine
- d-Calycanthine
- Calycanthine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Calycanthine
CAS:Calycanthine is a natural alkaloid exhibiting central nervous system toxicity, capable of inducing convulsions and seizures.Formula:C22H26N4Purity:99.97%Color and Shape:SolidMolecular weight:346.47Calycanthine
CAS:Controlled ProductApplications (+)-Calycanthine is a bitter and poisonous crystalline alkaloid that is obtained from seeds of plants of the genus Calycanthus and belongs to the family of Naphthyridines
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package
References Zhang, J., et al.: Chem. Biodivers., 6, 838 (2009); Zhang, J., et al.: Xibei Zhiwu Xuebao, 25, 2068 (2005)Formula:C22H26N4Color and Shape:NeatMolecular weight:346.48Calycanthine
CAS:Calycanthine is a biologically active compound, which is a natural alkaloid derived from certain plant species within the Calycanthaceae family. This compound is noted for its potent neuromuscular blocking properties. The mode of action of calycanthine involves interference with neurotransmission, specifically at synapses, where it disrupts normal acetylcholine activity, leading to muscular paralysis.Formula:C22H26N4Purity:Min. 95%Color and Shape:Off-White PowderMolecular weight:346.47 g/mol




