CAS 595-15-3

Soyasapogenol B

Description:

Soyasapogenol B is a triterpenoid saponin derived from soybeans, specifically from the saponin fraction of soybeans. It is characterized by its complex structure, which includes a steroid-like framework with multiple hydroxyl groups, contributing to its biological activity. This compound is known for its potential health benefits, including antioxidant properties and possible effects on cholesterol metabolism. Soyasapogenol B exhibits low solubility in water but is soluble in organic solvents, which is typical for many saponins. Its molecular structure allows it to interact with cell membranes, potentially influencing cellular processes. Additionally, it has been studied for its role in traditional medicine and its potential applications in nutraceuticals. The compound's safety profile and efficacy in various health-related applications continue to be areas of research, highlighting its significance in both food science and pharmacology. Overall, Soyasapogenol B represents a fascinating example of plant-derived compounds with diverse biological activities.

Formula: C₃₀H₅₀O₃

InChI: InChI=1S/C30H50O3/c1-25(2)16-20-19-8-9-22-27(4)12-11-23(32)28(5,18-31)21(27)10-13-30(22,7)29(19,6)15-14-26(20,3)24(33)17-25/h8,20-24,31-33H,9-18H2,1-7H3/t20-,21+,22+,23-,24+,26+,27-,28+,29+,30+/m0/s1

InChI key: InChIKey=YOQAQNKGFOLRGT-UXXABWCISA-N

SMILES: C[C@]12[C@@]3(C)C([C@]4([C@@](C)(CC3)[C@H](O)CC(C)(C)C4)[H])=CC[C@@]1([C@]5(C)[C@@](CC2)([C@](CO)(C)[C@@H](O)CC5)[H])[H]

Synonyms:

• (3Beta,22Beta)-Olean-12-Ene-3,22,24-Triol
• (3β,4β,22β)-Olean-12-ene-3,22,23-triol
• 3β,22β,24-Trihydroxyolean-12-ene
• Olean-12-en-3β,22β,24-triol
• Olean-12-ene-3,22,23-triol, (3beta,4beta,22beta)-
• Olean-12-ene-3,22,23-triol, (3β,4β,22β)-
• Olean-12-ene-3β,22β,24-triol
• Soyasapogenin B
• Soyasapogenol B
• Soyasapogenol I

SOYASAPOGENOL B(P)

CAS: 595-15-3

Formula: C₃₀H₅₀O₃

Purity: 98%

Molecular weight: 458.7162

Ref: IN-DA00ECP2

Soyasapogenol B

CAS: 595-15-3

Soyasapogenol B

Purity: ≥98%

Molecular weight: 458.72g/mol

Ref: 54-BUP07582

Soyasapogenol B

CAS: 595-15-3

Formula: C₃₀H₅₀O₃

Molecular weight: 458.73

Ref: 7W-GY8438

Soyasapogenol B

CAS: 595-15-3

Soyasapogenol B has anti-cancer, hypocholesterolemic, anticomplementary, hepatoprotective effects, it inhibits proliferation of cultured Hep-G2.

Formula: C₃₀H₅₀O₃

Purity: 95%~99%

Molecular weight: 458.727

Ref: BP-BP1329

Soyasapogenol B

CAS: 595-15-3

Soyasapogenol B has anti-cancer, hypocholesterolemic, anticomplementary, hepatoprotective effects, it inhibits proliferation of cultured Hep-G2.

Formula: C₃₀H₅₀O₃

Purity: 99.51% - 99.81%

Color and Shape: Solid

Molecular weight: 458.72

Ref: TM-TN2225

Soyasapogenol b

CAS: 595-15-3

Cyclic alcohol

Formula: C₃₀H₅₀O₃

Purity: ≥ 95.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 458.73

Ref: 5G-89797

Soyasapogenol B

Controlled Product

CAS: 595-15-3

Soyasapogenol B is a bioactive compound, classified as a soyasaponin, which is primarily derived from soybeans (Glycine max). Originating from the plant's seeds, Soyasapogenol B is part of a group of naturally occurring triterpenoid saponins. The mode of action of Soyasapogenol B involves its ability to modulate inflammatory pathways and potentially inhibit certain enzymes involved in inflammation. It acts on molecular targets that may reduce oxidative stress and modulate immune responses.

Formula: C₃₀H₅₀O₃

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 458.72 g/mol

Ref: 3D-FS42669