CAS 595-46-0
:Dimethylmalonic acid
Description:
Dimethylmalonic acid, with the CAS number 595-46-0, is a dicarboxylic acid characterized by its two carboxyl (-COOH) functional groups and two methyl (-CH3) groups attached to the central carbon chain. It is a colorless, crystalline solid that is soluble in water and polar organic solvents, making it versatile for various chemical applications. The compound has a molecular formula of C5H8O4 and features a relatively low melting point. Dimethylmalonic acid is known for its role as an intermediate in organic synthesis and can be used in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Additionally, it serves as a building block in the synthesis of more complex molecules, including amino acids and other biologically relevant compounds. Its structural similarity to malonic acid allows it to participate in similar chemical reactions, such as condensation and esterification. Due to its functional groups, dimethylmalonic acid can also act as a weak acid, contributing to its reactivity in various chemical processes.
Formula:C5H8O4
InChI:InChI=1S/C5H8O4/c1-5(2,3(6)7)4(8)9/h1-2H3,(H,6,7)(H,8,9)
InChI key:InChIKey=OREAFAJWWJHCOT-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C(O)=O)(C)C
Synonyms:- 2,2-Dimethyl-malonic acid
- 2,2-Dimethylpropanedioic acid
- 2,2-Propanedicarboxylic acid
- Dimethyl malonic acid
- Dimethyl-propanedioic acid
- Dimethylmalonicacid
- Dimethylpropanedioic Acid
- Malonic acid, dimethyl-
- NSC 836
- Propanedioic acid, 2,2-dimethyl-
- Propanedioic acid, dimethyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Ref: IN-DA0034RK
1g25.00€5g25.00€10g26.00€1kg221.00€25g32.00€5kgTo inquire100g64.00€10kgTo inquire250g106.00€500g166.00€Dimethylmalonic acid
CAS:Dimethylmalonic acidFormula:C5H8O4Purity:98%Color and Shape: white solidMolecular weight:132.11g/molDimethylmalonic acid
CAS:Dimethylmalonic acid, in human serum, prevents fish actinomyosin denaturation.Formula:C5H8O4Purity:≥98%Color and Shape:SolidMolecular weight:132.11Dimethylmalonic Acid
CAS:Formula:C5H8O4Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:132.12Dimethyl malonic acid
CAS:<p>Dimethyl malonic acid is an inorganic acid that contains a methyl group and two hydroxyl groups. Dimethyl malonic acid has been shown to have high values in analytical methods, such as x-ray crystal structures and high performance liquid chromatography. It is also used as a reagent for the determination of amino acids, including methylamine and ethylamine. This compound can be used as an intermediate in organic synthesis reactions. Dimethyl malonic acid has been shown to inhibit enzymes involved in fatty acid metabolism, such as carboxylase and acetyl-CoA carboxylase, which are involved in the formation of fatty acids. The use of this compound may lead to the production of less fatty acids and lower cholesterol levels.</p>Formula:C5H8O4Color and Shape:White Off-White PowderMolecular weight:132.11 g/mol






