CAS 595-46-0: Dimethylmalonic acid
Description:Dimethylmalonic acid, with the CAS number 595-46-0, is a dicarboxylic acid characterized by its two carboxyl (-COOH) functional groups and two methyl (-CH3) groups attached to the central carbon chain. It is a colorless, crystalline solid that is soluble in water and polar organic solvents, making it versatile for various chemical applications. The compound has a molecular formula of C5H8O4 and features a relatively low melting point. Dimethylmalonic acid is known for its role as an intermediate in organic synthesis and can be used in the production of pharmaceuticals, agrochemicals, and other fine chemicals. Additionally, it serves as a building block in the synthesis of more complex molecules, including amino acids and other biologically relevant compounds. Its structural similarity to malonic acid allows it to participate in similar chemical reactions, such as condensation and esterification. Due to its functional groups, dimethylmalonic acid can also act as a weak acid, contributing to its reactivity in various chemical processes.
Formula:C5H8O4
InChI:InChI=1S/C5H8O4/c1-5(2,3(6)7)4(8)9/h1-2H3,(H,6,7)(H,8,9)
InChI key:InChIKey=OREAFAJWWJHCOT-UHFFFAOYSA-N
SMILES:O=C(O)C(C(=O)O)(C)C
- Synonyms:
- 2,2-Dimethyl-malonic acid
- 2,2-Dimethylpropanedioic acid
- 2,2-Propanedicarboxylic acid
- Dimethyl malonic acid
- Dimethyl-propanedioic acid
- Dimethylmalonicacid
- Dimethylpropanedioic Acid
- Malonic acid, dimethyl-
- NSC 836
- Propanedioic acid, 2,2-dimethyl-
- See more synonyms
- Propanedioic acid, dimethyl-
