CAS 595-84-6
:2-Ethyl-2-methylpropanedioic acid
Description:
2-Ethyl-2-methylpropanedioic acid, also known as diethylmalonic acid, is a dicarboxylic acid characterized by its two carboxyl functional groups (-COOH) attached to a branched carbon chain. This compound has a molecular formula of C7H12O4 and features a central carbon backbone with ethyl and methyl substituents, contributing to its branched structure. It is typically a colorless to pale yellow solid at room temperature and is soluble in water and organic solvents, making it versatile for various applications. The presence of two carboxylic acid groups allows it to participate in various chemical reactions, including esterification and amidation, which are useful in organic synthesis. Additionally, 2-Ethyl-2-methylpropanedioic acid can act as a building block in the synthesis of pharmaceuticals, agrochemicals, and other organic compounds. Its unique structure and reactivity make it an interesting subject of study in organic chemistry and materials science. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C6H10O4
InChI:InChI=1/C6H10O4/c1-3-6(2,4(7)8)5(9)10/h3H2,1-2H3,(H,7,8)(H,9,10)
InChI key:InChIKey=OGAFKQWRXQJXJD-UHFFFAOYSA-N
SMILES:C(C(O)=O)(C(O)=O)(CC)C
Synonyms:- Propanedioic acid, 2-ethyl-2-methyl-
- Propanedioic acid, ethylmethyl-
- 2-Ethyl-2-methylpropanedioic acid
- Malonic acid, ethylmethyl-
- NSC 1163
- Ethylmethylmalonic acid
- 2,2-Butanedicarboxylic acid
- ethyl(methyl)propanedioic acid
- Malonic acid, ethylmethyl-
- 2-Ethyl-2-methylmalonic acid
- 2-ethyl-2-methyl-propanedioic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-Ethyl-2-methylpropanedioic acid
CAS:<p>2-Ethyl-2-methylpropanedioic acid is a molecule with the chemical formula CH3CO(CH2)4COOH. It is used in the production of calcium carbonate, which is used as a filler in paints, plastics and paper. 2-Ethyl-2-methylpropanedioic acid has a carboxyl group and hydroxyl group that are reactive with silicon. It also contains a fatty acid group and nitrogen atoms. The most common functional groups present in this molecule are the carbonyl group and the hydrocarbon group. It can be found on polyvinylpyrrolidone or as an additive in paint to increase its hardness and flexibility.</p>Formula:C6H10O4Purity:Min. 95%Molecular weight:146.14 g/mol
