CAS 59507-53-8: (3-bromophenyl)(piperidin-1-yl)methanone
Description:(3-bromophenyl)(piperidin-1-yl)methanone, with the CAS number 59507-53-8, is an organic compound characterized by its structural components, which include a brominated phenyl group and a piperidine moiety. The presence of the bromine atom at the meta position of the phenyl ring enhances its reactivity and can influence the compound's biological activity. The piperidine ring contributes to the compound's basicity and potential interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit properties typical of ketones, such as being polar and capable of forming hydrogen bonds, which can affect its solubility and reactivity. Its unique structure suggests potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. However, specific biological activities and safety profiles would require further investigation through experimental studies. Overall, (3-bromophenyl)(piperidin-1-yl)methanone represents a versatile scaffold for further chemical exploration and development.
Formula:C12H14BrNO
InChI:InChI=1/C12H14BrNO/c13-11-6-4-5-10(9-11)12(15)14-7-2-1-3-8-14/h4-6,9H,1-3,7-8H2
- Synonyms:
- Methanone, (3-Bromophenyl)-1-Piperidinyl-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | (3-bromophenylcarbonyl)piperidine REF: IN-DA00EBNFCAS: 59507-53-8 | - - - | To inquire | Mon 28 Apr 25 |
![]() | 1-(3-Bromobenzoyl)piperidine REF: 10-F094043CAS: 59507-53-8 | 95.0% | To inquire | Thu 08 May 25 |

1-(3-Bromobenzoyl)piperidine
Ref: 10-F094043
1g | To inquire | ||
5g | To inquire |