CAS 5951-58-6
:Drimane
Description:
Drimane, with the CAS number 5951-58-6, is a bicyclic sesquiterpene characterized by its unique structure, which includes a drimane skeleton. This compound is typically found in various natural sources, particularly in certain essential oils and plant extracts. Drimane exhibits a pleasant, woody aroma, making it valuable in the fragrance and flavor industries. Its chemical structure contributes to its stability and reactivity, allowing it to participate in various chemical reactions, including oxidation and polymerization. Additionally, drimane has been studied for its potential biological activities, including antimicrobial and anti-inflammatory properties, although further research is necessary to fully understand its pharmacological potential. The compound is generally considered to have low toxicity, but safety assessments are essential for its use in consumer products. Overall, drimane is an interesting compound with applications in both natural product chemistry and industrial formulations.
Formula:C15H28
InChI:InChI=1S/C15H28/c1-11-7-8-13-14(3,4)9-6-10-15(13,5)12(11)2/h11-13H,6-10H2,1-5H3/t11-,12-,13-,15+/m0/s1
InChI key:InChIKey=CVRSZZJUWRLRDE-PWNZVWSESA-N
SMILES:C[C@@]12[C@](C(C)(C)CCC1)(CC[C@H](C)[C@@H]2C)[H]
Synonyms:- Naphthalene, decahydro-1,2,5,5,8a-pentamethyl-, stereoisomer
- Naphthalene, decahydro-1,1,4a,5,6-pentamethyl-, (4aR,5S,6S,8aS)-
- Naphthalene, decahydro-1,1,4a,5,6-pentamethyl-, [4aR-(4aα,5α,6α,8aβ)]-
- Drimane
- (4aR,5S,6S,8aS)-Decahydro-1,1,4a,5,6-pentamethylnaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
