CAS 5951-67-7
:(6S)-6-ethenyl-6-methyl-1-(propan-2-yl)-3-(propan-2-ylidene)cyclohexene
Description:
The chemical substance known as (6S)-6-ethenyl-6-methyl-1-(propan-2-yl)-3-(propan-2-ylidene)cyclohexene, with the CAS number 5951-67-7, is a bicyclic compound characterized by its complex structure featuring multiple substituents on a cyclohexene ring. This compound exhibits stereochemistry, indicated by the (6S) configuration, which suggests specific spatial arrangements of its atoms that can influence its reactivity and interactions. The presence of both ethenyl and isopropyl groups contributes to its hydrophobic nature, making it less soluble in polar solvents. Its unique structure may impart interesting properties, such as potential applications in organic synthesis or as a precursor in the production of more complex molecules. Additionally, the compound's reactivity can be influenced by the presence of double bonds and steric hindrance from bulky substituents. Overall, this substance is of interest in the fields of organic chemistry and materials science, where understanding its characteristics can lead to innovative applications.
Formula:C15H24
InChI:InChI=1/C15H24/c1-7-15(6)9-8-13(11(2)3)10-14(15)12(4)5/h7,10,12H,1,8-9H2,2-6H3/t15-/m1/s1
Synonyms:- (+)-a-Elemene
- (6S)-1-isopropyl-3-isopropylidene-6-methyl-6-vinylcyclohexene
- (S)-6-Ethenyl-6-methyl-1-(1-methylethyl)-3-(1-methylethylidene)cyclohexene
- cyclohexene, 6-ethenyl-6-methyl-1-(1-methylethyl)-3-(1-methylethylidene)-, (6S)-
- Cyclohexene, 6-ethenyl-6-methyl-1-(1-methylethyl)-3-(1-methylethylidene)-, (S)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
α-Elemene
CAS:α-Elemene is a sesquiterpene, which is a type of natural product, known for its presence in the essential oil of certain plants such as Curcuma and other members of the Zingiberaceae family. This compound is primarily extracted from these botanical sources through processes like steam distillation and is characterized by its hydrophobic and volatile nature.
Formula:C15H24Purity:Min. 95%Molecular weight:204.35 g/mol

